[(S)-1-((S)-1-{[(3,3-Dimethyl-2-oxo-butylcarbamoyl)-methyl]-carbamoyl}-ethylcarbamoyl)-3-methyl-butyl]-carbamic acid tert-butyl ester

ID: ALA101240

PubChem CID: 44332639

Max Phase: Preclinical

Molecular Formula: C22H40N4O7

Molecular Weight: 472.58

Molecule Type: Protein

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](C)C(=O)NCC(=O)NCC(=O)OC(C)(C)C

Standard InChI:  InChI=1S/C22H40N4O7/c1-13(2)10-15(26-20(31)33-22(7,8)9)19(30)25-14(3)18(29)24-11-16(27)23-12-17(28)32-21(4,5)6/h13-15H,10-12H2,1-9H3,(H,23,27)(H,24,29)(H,25,30)(H,26,31)/t14-,15-/m0/s1

Standard InChI Key:  SJQQLUSBNNZLDG-GJZGRUSLSA-N

Molfile:  

     RDKit          2D

 33 32  0  0  1  0  0  0  0  0999 V2000
    4.3042   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1625   -3.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0167   -3.8167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750   -4.2042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4500   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917   -3.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1667   -4.2292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7375   -4.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5917   -4.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7417   -3.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4417   -4.2042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1667   -2.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3125   -3.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3000   -5.0417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4542   -4.2417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4500   -2.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917   -2.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5917   -5.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7417   -3.0042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7292   -3.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1667   -3.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8792   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0167   -4.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3042   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7375   -5.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8792   -4.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1542   -3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3792   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0167   -4.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7375   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3125   -1.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1042   -2.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  1  1  0
  4  6  1  0
  5  8  1  0
  6  1  1  0
  7  5  1  0
  8  3  1  0
  9 22  1  0
 10 23  1  0
 11  2  1  0
 12  2  2  0
 13  9  1  0
 14  1  2  0
 15 10  1  0
 16  5  2  0
  6 17  1  1
 18  9  2  0
 19 10  2  0
 20 11  1  0
 21 15  1  0
 22  7  1  0
 23 13  1  0
 24 17  1  0
  8 25  1  6
 26 21  1  0
 27 21  1  0
 28 21  1  0
 29 20  1  0
 30 20  1  0
 31 20  1  0
 32 24  1  0
 33 24  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA101240

   Boc-Leu-Ala-Gly-Gly-OtBu

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Protein

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 472.58

Molecular Weight (Monoisotopic): 472.2897

AlogP: 1.00

#Rotatable Bonds: 10

Polar Surface Area: 151.93

Molecular Species: NEUTRAL

HBA: 7

HBD: 4

#RO5 Violations: ┄

HBA (Lipinski): 11

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 11.93

CX Basic pKa: ┄

CX LogP: 0.62

CX LogD: 0.62

Aromatic Rings: ┄

Heavy Atoms: 33

QED Weighted: 0.35

Np Likeness Score: -0.59

References

1. Cornish JA, Murray H, Kemp GD, Gani D.  (1995)  Inhibitors of the adenovirus type 2 proteinase based on substrate-like tetrapeptide nitriles,  5  (1): [10.1016/0960-894X(94)00452-L]

Source

Source(1):

• Scientific Literature