2-[2-(2-Acetylamino-3-hydroxy-propionylamino)-3-methyl-butyrylamino]-pentanedioic acid diamide

ID: ALA104642

PubChem CID: 14999600

Max Phase: Preclinical

Molecular Formula: C15H27N5O6

Molecular Weight: 373.41

Molecule Type: Protein

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(N)=O)C(C)C

Standard InChI:  InChI=1S/C15H27N5O6/c1-7(2)12(20-14(25)10(6-21)18-8(3)22)15(26)19-9(13(17)24)4-5-11(16)23/h7,9-10,12,21H,4-6H2,1-3H3,(H2,16,23)(H2,17,24)(H,18,22)(H,19,26)(H,20,25)/t9-,10-,12-/m0/s1

Standard InChI Key:  WWRCDYXWBTZDPC-NHCYSSNCSA-N

Molfile:  

     RDKit          2D

 26 25  0  0  1  0  0  0  0  0999 V2000
   10.8125   -5.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4042   -5.8917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7000   -6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9917   -5.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1042   -6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5167   -6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2917   -6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9292   -6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2250   -5.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   -5.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9292   -3.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8125   -5.0750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7000   -7.1125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9292   -7.1125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   -5.0750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6292   -3.4500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2250   -5.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6292   -5.8917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1042   -7.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9292   -4.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2250   -3.4500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9917   -5.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7000   -4.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8792   -6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4042   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8125   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3  2  1  0
  4  3  1  0
  5  1  1  0
  6  1  1  0
  7  4  1  0
  8  9  1  0
  9  6  1  0
 10  7  1  0
 11 20  1  0
 12  1  2  0
 13  3  2  0
 14  8  2  0
 15 10  2  0
 16 11  2  0
  9 17  1  1
 18  8  1  0
  5 19  1  6
 20 17  1  0
 21 11  1  0
  4 22  1  1
 23 22  1  0
 24 10  1  0
 25 19  1  0
 26 19  1  0
M  END

Associated Targets(non-human)

Kallikrein 1 (28 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 373.41Molecular Weight (Monoisotopic): 373.1961AlogP: -3.14#Rotatable Bonds: 11
Polar Surface Area: 193.71Molecular Species: NEUTRALHBA: 6HBD: 6
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.85CX Basic pKa: CX LogP: -3.96CX LogD: -3.96
Aromatic Rings: Heavy Atoms: 26QED Weighted: 0.22Np Likeness Score: 0.15

References

1. Deshpande MS, Burton J..  (1992)  Mapping the binding site of tissue kallikrein: preparation and testing of all possible substrate analog inhibitors homologous with the sequence of kininogen between Ser386 and Gln392.,  35  (17): [PMID:1507198] [10.1021/jm00095a002]

Source