The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Acetylamino-5-guanidino-pentanoic acid [1-(1-carbamoyl-2-methyl-propylcarbamoyl)-2-hydroxy-ethyl]-amide ID: ALA104918
PubChem CID: 14999613
Max Phase: Preclinical
Molecular Formula: C16H31N7O5
Molecular Weight: 401.47
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CO)C(=O)N[C@H](C(N)=O)C(C)C
Standard InChI: InChI=1S/C16H31N7O5/c1-8(2)12(13(17)26)23-15(28)11(7-24)22-14(27)10(21-9(3)25)5-4-6-20-16(18)19/h8,10-12,24H,4-7H2,1-3H3,(H2,17,26)(H,21,25)(H,22,27)(H,23,28)(H4,18,19,20)/t10-,11-,12-/m0/s1
Standard InChI Key: NIYNFIBEISWDIC-SRVKXCTJSA-N
Molfile:
RDKit 2D
28 27 0 0 1 0 0 0 0 0999 V2000
9.2042 -10.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5000 -11.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3875 -10.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -11.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7917 -10.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9042 -11.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -14.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6125 -10.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9750 -10.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2667 -11.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6792 -11.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7917 -14.8417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5000 -11.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3875 -9.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6125 -9.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2667 -11.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -13.6167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3875 -14.8417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3167 -11.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9042 -11.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7917 -9.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5000 -9.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5667 -10.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6792 -11.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3875 -13.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2042 -12.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6125 -12.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3875 -12.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 4 1 0
4 5 1 0
5 2 1 0
6 1 1 0
7 17 2 0
8 6 1 0
9 11 1 0
10 9 1 0
11 3 1 0
12 7 1 0
13 2 2 0
14 3 2 0
15 8 2 0
16 10 2 0
17 25 1 0
18 7 1 0
19 8 1 0
6 20 1 6
5 21 1 1
22 21 1 0
23 10 1 0
11 24 1 6
25 28 1 0
26 20 1 0
27 20 1 0
28 24 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.47Molecular Weight (Monoisotopic): 401.2387AlogP: -3.35#Rotatable Bonds: 12Polar Surface Area: 215.02Molecular Species: BASEHBA: 6HBD: 7#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 10#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.90CX Basic pKa: 10.87CX LogP: -4.04CX LogD: -6.14Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.10Np Likeness Score: 0.53
References 1. Deshpande MS, Burton J.. (1992) Mapping the binding site of tissue kallikrein: preparation and testing of all possible substrate analog inhibitors homologous with the sequence of kininogen between Ser386 and Gln392., 35 (17): [PMID:1507198 ] [10.1021/jm00095a002 ]