The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Disodium; 4-(phosphoniumoxy)benzyl 2-{(E)-[(aminocarbonothioyl)hydrazono]methyl}pyridin-3-ylcarbamate ID: ALA107419
PubChem CID: 10322425
Max Phase: Preclinical
Molecular Formula: C15H14N5Na2O6PS
Molecular Weight: 425.36
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N/C(S)=N/N=C/c1ncccc1NC(=O)OCc1ccc(OP(=O)([O-])[O-])cc1.[Na+].[Na+]
Standard InChI: InChI=1S/C15H16N5O6PS.2Na/c16-14(28)20-18-8-13-12(2-1-7-17-13)19-15(21)25-9-10-3-5-11(6-4-10)26-27(22,23)24;;/h1-8H,9H2,(H,19,21)(H3,16,20,28)(H2,22,23,24);;/q;2*+1/p-2/b18-8+;;
Standard InChI Key: ZJCBTSKKVHKNSP-YAOYWCTKSA-L
Molfile:
RDKit 2D
30 29 0 0 0 0 0 0 0 0999 V2000
10.4792 -5.6167 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
9.0667 -3.7917 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.5375 -4.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0500 -6.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7125 -4.3792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0000 -5.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0000 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5375 -6.0417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2792 -4.5917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8917 -3.7917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -3.7917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7125 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 -5.4167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2792 -6.0417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2792 -2.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2500 -6.4542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5292 -3.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3625 -4.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7625 -6.6542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4167 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7625 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9417 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -4.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -4.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1750 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2792 -4.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5667 -5.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5667 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1667 -4.3375 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
3 18 1 0
4 16 2 0
5 3 1 0
6 7 1 0
7 5 1 0
8 12 2 0
9 2 1 0
10 2 1 0
11 2 1 0
12 6 1 0
13 4 1 0
14 6 2 0
15 2 2 0
16 8 1 0
17 3 2 0
18 22 1 0
19 4 1 0
20 11 1 0
21 26 2 0
22 21 1 0
23 20 1 0
24 20 2 0
25 23 2 0
26 24 1 0
27 7 2 0
28 29 2 0
29 27 1 0
25 21 1 0
14 28 1 0
M CHG 4 1 1 9 -1 10 -1 30 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.36Molecular Weight (Monoisotopic): 425.0559AlogP: 1.88#Rotatable Bonds: 7Polar Surface Area: 168.72Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.88CX Basic pKa: 3.63CX LogP: 1.74CX LogD: -1.99Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.15Np Likeness Score: -0.53
References 1. Li J, Luo X, Wang Q, Zheng LM, King I, Doyle TW, Chen SH.. (1998) Synthesis and biological evaluation of a water soluble phosphate prodrug of 3-aminopyridine-2-carboxaldehyde thiosemicarbazone (3-AP)., 8 (22): [PMID:9873695 ] [10.1016/s0960-894x(98)00573-3 ]