The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Hydroxy-3-O-isobutyrylproceranolide ID: ALA1075769
PubChem CID: 44613428
Max Phase: Preclinical
Molecular Formula: C31H40O9
Molecular Weight: 556.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C[C@H]1C(C)(C)[C@H](OC(=O)C(C)C)[C@]2(O)CC3=C4CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CC[C@@H]3[C@@]1(C)C2=O
Standard InChI: InChI=1S/C31H40O9/c1-16(2)25(34)40-27-28(3,4)21(13-22(32)37-7)30(6)19-8-10-29(5)20(18(19)14-31(27,36)26(30)35)12-23(33)39-24(29)17-9-11-38-15-17/h9,11,15-16,19,21,24,27,36H,8,10,12-14H2,1-7H3/t19-,21-,24-,27-,29+,30+,31-/m0/s1
Standard InChI Key: CRFHOAFXPBYTOF-AMPYYUHWSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
5.7916 -4.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5037 -4.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2157 -4.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2122 -5.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9209 -6.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6377 -5.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6413 -4.9186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9279 -4.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9288 -3.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5976 -3.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3449 -2.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5198 -2.4051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2628 -3.1890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3499 -6.1601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2083 -4.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5037 -6.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7916 -5.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0859 -6.1477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0860 -6.9679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5100 -6.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3666 -6.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3625 -7.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0750 -7.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7875 -7.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7958 -6.5500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6666 -5.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6551 -6.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9377 -6.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2262 -6.1264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9318 -7.3690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2321 -5.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5625 -7.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1458 -8.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0768 -8.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3708 -7.9583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3632 -9.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6478 -8.6198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3650 -9.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6514 -10.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0804 -10.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0750 -5.3250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 17 1 0
1 2 1 0
16 4 2 0
16 20 1 0
17 18 1 0
18 19 1 0
19 24 1 0
24 20 1 0
3 2 1 0
18 21 1 0
10 11 2 0
21 22 1 0
11 12 1 0
22 23 1 0
12 13 1 0
23 24 1 0
13 9 2 0
19 25 2 0
8 9 1 6
18 26 1 6
3 4 1 0
21 27 1 6
6 14 2 0
27 28 1 0
3 8 1 0
28 29 1 0
28 30 2 0
4 5 1 0
29 31 1 0
22 32 1 0
5 6 1 0
22 33 1 0
23 34 1 1
6 7 1 0
24 35 1 6
34 36 1 0
7 8 1 0
36 37 2 0
3 15 1 6
36 38 1 0
16 17 1 0
38 39 1 0
9 10 1 0
38 40 1 0
17 41 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.65Molecular Weight (Monoisotopic): 556.2672AlogP: 4.48#Rotatable Bonds: 5Polar Surface Area: 129.34Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.00CX Basic pKa: ┄CX LogP: 3.97CX LogD: 3.97Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: 2.83
References 1. Lin BD, Yuan T, Zhang CR, Dong L, Zhang B, Wu Y, Yue JM.. (2009) Structurally diverse limonoids from the fruits of Swietenia mahagoni., 72 (12): [PMID:19902967 ] [10.1021/np900522h ]