The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
L-Aspartyl amide of betulonic acid ID: ALA1076456
PubChem CID: 44606237
Max Phase: Preclinical
Molecular Formula: C36H55NO6
Molecular Weight: 597.84
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: L-Aspartyl Amide Of Betulonic Acid | CHEMBL1076456|L-Aspartyl amide of betulonic acid
Canonical SMILES: C=C(C)[C@@H]1CC[C@]2(C(=O)N[C@@H](CC(=O)OC)C(=O)OC)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C36H55NO6/c1-21(2)22-12-17-36(31(41)37-24(30(40)43-9)20-28(39)42-8)19-18-34(6)23(29(22)36)10-11-26-33(5)15-14-27(38)32(3,4)25(33)13-16-35(26,34)7/h22-26,29H,1,10-20H2,2-9H3,(H,37,41)/t22-,23+,24-,25-,26+,29+,33-,34+,35+,36-/m0/s1
Standard InChI Key: CNKAIOOJMTUXNC-OEPSMHLBSA-N
Molfile:
RDKit 2D
47 51 0 0 0 0 0 0 0 0999 V2000
-5.6455 0.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6455 -0.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9335 -0.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9335 0.9062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2213 0.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2206 -0.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5124 -0.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7944 -0.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5039 0.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7949 0.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7794 2.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5024 1.7266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0654 1.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0822 0.8861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3792 0.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6590 0.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3505 2.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6474 1.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0272 2.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3434 2.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1624 2.9105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2252 1.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8049 1.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0871 0.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0611 1.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7768 1.6891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7037 3.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4331 4.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5157 3.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3553 -1.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5306 -1.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3650 -0.7495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0600 0.4480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4946 1.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2139 1.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9317 1.2700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6512 1.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2155 2.5161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4930 0.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2108 0.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2092 -0.8031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9301 0.4402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6479 0.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2303 -1.1607 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.5126 0.0764 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.3592 1.2828 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0719 2.5453 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5 4 1 0
5 22 1 1
5 6 1 0
10 23 1 1
14 24 1 6
9 12 1 0
18 25 1 1
10 14 1 0
25 26 1 0
13 11 1 0
21 27 1 6
11 12 1 0
27 28 2 0
13 14 1 0
27 29 1 0
1 2 1 0
3 30 1 0
1 4 1 0
3 31 1 0
2 3 1 0
2 32 2 0
5 9 1 0
25 33 2 0
13 17 1 0
26 34 1 0
14 15 1 0
34 35 1 6
15 16 1 0
35 36 1 0
16 18 1 0
36 37 1 0
17 18 1 0
35 38 2 0
6 7 1 0
34 39 1 0
7 8 1 0
39 40 1 0
8 10 1 0
40 41 2 0
9 10 1 0
40 42 1 0
3 6 1 0
42 43 1 0
18 19 1 0
6 44 1 6
19 20 1 0
9 45 1 6
20 21 1 0
17 46 1 6
21 17 1 0
13 47 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.84Molecular Weight (Monoisotopic): 597.4029AlogP: 6.43#Rotatable Bonds: 6Polar Surface Area: 98.77Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.46CX Basic pKa: 0.50CX LogP: 6.32CX LogD: 6.32Aromatic Rings: ┄Heavy Atoms: 43QED Weighted: 0.28Np Likeness Score: 2.28
References 1. Pohjala L, Alakurtti S, Ahola T, Yli-Kauhaluoma J, Tammela P.. (2009) Betulin-derived compounds as inhibitors of alphavirus replication., 72 (11): [PMID:19839605 ] [10.1021/np9003245 ]