The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
28-O-Tetrahydropyranylbetulin ID: ALA1076457
PubChem CID: 10940350
Max Phase: Preclinical
Molecular Formula: C35H58O3
Molecular Weight: 526.85
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 28-O-Tetrahydropyranylbetulin | 28-O-Tetrahydropyranylbetulin|CHEMBL1076457|SCHEMBL13293181|3-Hydroxy-28-[(tetrahydro-2H-pyran-2-yl)oxy]lup-20(29)-ene
Canonical SMILES: C=C(C)[C@@H]1CC[C@]2(COC3CCCCO3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C35H58O3/c1-23(2)24-13-18-35(22-38-29-10-8-9-21-37-29)20-19-33(6)25(30(24)35)11-12-27-32(5)16-15-28(36)31(3,4)26(32)14-17-34(27,33)7/h24-30,36H,1,8-22H2,2-7H3/t24-,25+,26-,27+,28-,29?,30+,32-,33+,34+,35+/m0/s1
Standard InChI Key: YAPARWBJTHNGRG-GVOHDUADSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
6.2820 0.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2820 0.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9940 -0.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9940 1.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7062 0.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7069 0.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4151 -0.3063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1331 0.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4236 1.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1326 0.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1481 2.5761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4251 2.1695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8621 2.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8453 1.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5483 0.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2685 1.3049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5770 2.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2801 2.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9003 2.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5841 3.4217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7651 3.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7023 1.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1226 1.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8404 0.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9886 1.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7043 2.1320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2238 3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4944 4.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4118 3.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5721 -1.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3968 -1.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -0.3067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4221 1.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4158 0.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1295 0.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8513 0.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8549 1.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1367 2.1302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6972 -0.7178 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.4149 0.5193 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.5683 1.7258 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.8557 2.9882 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3 6 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
5 4 1 0
5 22 1 1
5 6 1 0
10 23 1 1
14 24 1 6
9 12 1 0
18 25 1 1
10 14 1 0
25 26 1 0
13 11 1 0
21 27 1 6
11 12 1 0
27 28 2 0
13 14 1 0
27 29 1 0
1 2 1 0
3 30 1 0
1 4 1 0
3 31 1 0
2 3 1 0
2 32 1 1
5 9 1 0
26 33 1 0
33 34 1 0
13 17 1 0
14 15 1 0
15 16 1 0
16 18 1 0
17 18 1 0
33 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
6 7 1 0
6 39 1 6
7 8 1 0
9 40 1 6
8 10 1 0
17 41 1 6
9 10 1 0
13 42 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.85Molecular Weight (Monoisotopic): 526.4386AlogP: 8.55#Rotatable Bonds: 4Polar Surface Area: 38.69Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.71CX LogD: 7.71Aromatic Rings: ┄Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: 2.68
References 1. Pohjala L, Alakurtti S, Ahola T, Yli-Kauhaluoma J, Tammela P.. (2009) Betulin-derived compounds as inhibitors of alphavirus replication., 72 (11): [PMID:19839605 ] [10.1021/np9003245 ]