The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-O-Acetyl-28-O-mesylbetulin ID: ALA1076459
PubChem CID: 12136706
Max Phase: Preclinical
Molecular Formula: C33H54O5S
Molecular Weight: 562.86
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@@H]1CC[C@]2(COS(C)(=O)=O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C33H54O5S/c1-21(2)23-12-17-33(20-37-39(9,35)36)19-18-31(7)24(28(23)33)10-11-26-30(6)15-14-27(38-22(3)34)29(4,5)25(30)13-16-32(26,31)8/h23-28H,1,10-20H2,2-9H3/t23-,24+,25-,26+,27-,28+,30-,31+,32+,33+/m0/s1
Standard InChI Key: SRWQTBNNXLUBTN-WAEOCRLMSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
5.4694 -5.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4694 -5.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1818 -6.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1818 -4.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8941 -5.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8950 -5.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6034 -6.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3216 -5.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6120 -4.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3211 -5.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3367 -3.4221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6133 -3.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0510 -3.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0340 -4.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7373 -5.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4578 -4.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7660 -3.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4694 -3.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0898 -3.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7735 -2.5761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9542 -2.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8902 -4.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3111 -4.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0291 -5.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1781 -4.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8941 -3.8662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4126 -2.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6834 -1.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6004 -2.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7597 -7.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5847 -7.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7496 -6.3059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8851 -6.7170 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.6032 -5.4796 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.7573 -4.2726 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.0444 -3.0097 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.0316 -5.8895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3120 -6.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0331 -5.0594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6122 -4.2826 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.3319 -3.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8860 -4.6902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1948 -4.8634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
5 4 1 0
5 22 1 1
5 6 1 0
10 23 1 1
14 24 1 6
9 12 1 0
18 25 1 1
10 14 1 0
25 26 1 0
13 11 1 0
21 27 1 6
11 12 1 0
27 28 2 0
13 14 1 0
27 29 1 0
1 2 1 0
3 30 1 0
1 4 1 0
3 31 1 0
2 3 1 0
2 32 1 1
5 9 1 0
6 33 1 6
13 17 1 0
9 34 1 6
14 15 1 0
17 35 1 6
15 16 1 0
13 36 1 1
16 18 1 0
32 37 1 0
17 18 1 0
37 38 1 0
6 7 1 0
37 39 2 0
7 8 1 0
26 40 1 0
8 10 1 0
40 41 1 0
9 10 1 0
40 42 2 0
3 6 1 0
40 43 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.86Molecular Weight (Monoisotopic): 562.3692AlogP: 7.55#Rotatable Bonds: 5Polar Surface Area: 69.67Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.54CX LogD: 6.54Aromatic Rings: ┄Heavy Atoms: 39QED Weighted: 0.20Np Likeness Score: 2.75
References 1. Pohjala L, Alakurtti S, Ahola T, Yli-Kauhaluoma J, Tammela P.. (2009) Betulin-derived compounds as inhibitors of alphavirus replication., 72 (11): [PMID:19839605 ] [10.1021/np9003245 ]