The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,28-Di-O-levulinoylbetulin ID: ALA1076487
PubChem CID: 44606415
Max Phase: Preclinical
Molecular Formula: C40H62O6
Molecular Weight: 638.93
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@@H]1CC[C@]2(COC(=O)CCC(C)=O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(=O)CCC(C)=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C40H62O6/c1-25(2)28-16-21-40(24-45-33(43)14-10-26(3)41)23-22-38(8)29(35(28)40)12-13-31-37(7)19-18-32(46-34(44)15-11-27(4)42)36(5,6)30(37)17-20-39(31,38)9/h28-32,35H,1,10-24H2,2-9H3/t28-,29+,30-,31+,32-,35+,37-,38+,39+,40+/m0/s1
Standard InChI Key: MPYRHKXJGWVFDV-JJGSAGOCSA-N
Molfile:
RDKit 2D
50 54 0 0 0 0 0 0 0 0999 V2000
21.7876 -22.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9314 -23.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9314 -24.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6432 -24.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6432 -22.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3549 -23.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3558 -24.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0636 -24.6226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7811 -24.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0721 -22.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7808 -23.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7963 -21.7416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0736 -22.1480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5099 -22.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4931 -22.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1956 -23.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9156 -23.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2244 -21.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9271 -22.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5471 -21.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2309 -20.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4123 -20.9647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3510 -22.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7706 -22.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4881 -23.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6353 -22.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8714 -20.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1419 -19.5558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0598 -20.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2214 -25.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0457 -25.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3460 -25.0339 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.0634 -23.7974 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.2157 -22.5915 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.5033 -21.3297 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.2129 -24.6238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3539 -22.1826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0718 -22.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0711 -23.4272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4950 -24.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7764 -24.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4954 -23.3793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0584 -24.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3398 -24.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6219 -24.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3394 -25.4514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5081 -22.5902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2241 -22.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9446 -22.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2196 -21.3423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6 7 1 0
11 24 1 1
15 25 1 6
10 13 1 0
19 26 1 1
11 15 1 0
22 27 1 6
14 12 1 0
27 28 2 0
12 13 1 0
27 29 1 0
14 15 1 0
4 30 1 0
2 3 1 0
4 31 1 0
2 5 1 0
7 32 1 6
3 4 1 0
10 33 1 6
6 10 1 0
18 34 1 6
14 18 1 0
14 35 1 1
15 16 1 0
3 36 1 1
16 17 1 0
26 37 1 0
17 19 1 0
37 38 1 0
38 1 1 0
18 19 1 0
38 39 2 0
7 8 1 0
36 40 1 0
8 9 1 0
40 41 1 0
9 11 1 0
40 42 2 0
10 11 1 0
41 43 1 0
4 7 1 0
43 44 1 0
19 20 1 0
44 45 1 0
20 21 1 0
44 46 2 0
21 22 1 0
1 47 1 0
22 18 1 0
47 48 1 0
6 5 1 0
48 49 1 0
6 23 1 1
48 50 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 638.93Molecular Weight (Monoisotopic): 638.4546AlogP: 8.84#Rotatable Bonds: 10Polar Surface Area: 86.74Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.36CX LogD: 7.36Aromatic Rings: ┄Heavy Atoms: 46QED Weighted: 0.18Np Likeness Score: 2.37
References 1. Pohjala L, Alakurtti S, Ahola T, Yli-Kauhaluoma J, Tammela P.. (2009) Betulin-derived compounds as inhibitors of alphavirus replication., 72 (11): [PMID:19839605 ] [10.1021/np9003245 ]