The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
28-O-Cinnamoylbetulin ID: ALA1076489
PubChem CID: 44606585
Max Phase: Preclinical
Molecular Formula: C39H56O3
Molecular Weight: 572.87
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 28-O-Cinnamoylbetulin | 28-O-Cinnamoylbetulin|CHEMBL1076489
Canonical SMILES: C=C(C)[C@@H]1CC[C@]2(COC(=O)/C=C/c3ccccc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C39H56O3/c1-26(2)28-17-22-39(25-42-33(41)16-13-27-11-9-8-10-12-27)24-23-37(6)29(34(28)39)14-15-31-36(5)20-19-32(40)35(3,4)30(36)18-21-38(31,37)7/h8-13,16,28-32,34,40H,1,14-15,17-25H2,2-7H3/b16-13+/t28-,29+,30-,31+,32-,34+,36-,37+,38+,39+/m0/s1
Standard InChI Key: LXCNPSDULNZQOW-RRKSSEBOSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
4.3812 -30.7498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3812 -31.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0931 -31.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0931 -30.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8048 -30.7498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8057 -31.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5135 -31.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2311 -31.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5220 -30.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2306 -30.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2462 -29.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5234 -29.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9599 -29.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9429 -30.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6456 -30.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3656 -30.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6743 -29.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3772 -29.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9971 -29.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6810 -28.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8624 -28.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8009 -29.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2206 -29.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9381 -31.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0854 -29.9610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3213 -27.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5918 -26.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5096 -27.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6712 -32.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4956 -32.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7958 -32.3985 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.5132 -31.1620 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.6657 -29.9560 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.9533 -28.6940 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.6626 -31.9884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8041 -29.5469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5220 -29.9623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5213 -30.7917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2371 -29.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9583 -29.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6715 -29.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3908 -29.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1036 -29.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0971 -28.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3720 -28.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6623 -28.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 17 1 0
5 4 1 0
5 22 1 1
5 6 1 0
10 23 1 1
14 24 1 6
9 12 1 0
18 25 1 1
10 14 1 0
21 26 1 6
13 11 1 0
26 27 2 0
11 12 1 0
26 28 1 0
13 14 1 0
3 29 1 0
1 2 1 0
3 30 1 0
1 4 1 0
6 31 1 6
2 3 1 0
9 32 1 6
5 9 1 0
17 33 1 6
13 17 1 0
13 34 1 1
14 15 1 0
2 35 1 1
15 16 1 0
25 36 1 0
16 18 1 0
36 37 1 0
37 39 1 0
17 18 1 0
37 38 2 0
6 7 1 0
7 8 1 0
39 40 2 0
8 10 1 0
40 41 1 0
9 10 1 0
41 42 2 0
3 6 1 0
42 43 1 0
18 19 1 0
43 44 2 0
19 20 1 0
44 45 1 0
20 21 1 0
45 46 2 0
46 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 572.87Molecular Weight (Monoisotopic): 572.4229AlogP: 9.26#Rotatable Bonds: 5Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 9.20CX LogD: 9.20Aromatic Rings: 1Heavy Atoms: 42QED Weighted: 0.22Np Likeness Score: 2.55
References 1. Pohjala L, Alakurtti S, Ahola T, Yli-Kauhaluoma J, Tammela P.. (2009) Betulin-derived compounds as inhibitors of alphavirus replication., 72 (11): [PMID:19839605 ] [10.1021/np9003245 ] 2. Yang SJ, Liu MC, Xiang HM, Zhao Q, Xue W, Yang S.. (2015) Synthesis and in vitro antitumor evaluation of betulin acid ester derivatives as novel apoptosis inducers., 102 [PMID:26280921 ] [10.1016/j.ejmech.2015.08.004 ]