The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
28-O-(N-Acetylanthraniloyl)betulin ID: ALA1076490
PubChem CID: 23627401
Max Phase: Preclinical
Molecular Formula: C39H57NO4
Molecular Weight: 603.89
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@@H]1CC[C@]2(COC(=O)c3ccccc3NC(C)=O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C39H57NO4/c1-24(2)26-15-20-39(23-44-34(43)27-11-9-10-12-29(27)40-25(3)41)22-21-37(7)28(33(26)39)13-14-31-36(6)18-17-32(42)35(4,5)30(36)16-19-38(31,37)8/h9-12,26,28,30-33,42H,1,13-23H2,2-8H3,(H,40,41)/t26-,28+,30-,31+,32-,33+,36-,37+,38+,39+/m0/s1
Standard InChI Key: QNDIGNIVTOJCRU-GTUFNTTASA-N
Molfile:
RDKit 2D
48 53 0 0 0 0 0 0 0 0999 V2000
16.0542 -30.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0542 -31.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7661 -31.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7661 -30.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4778 -30.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4787 -31.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1865 -31.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9041 -31.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1951 -30.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9037 -30.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9193 -28.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1965 -29.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6330 -29.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6161 -30.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3187 -30.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0387 -30.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3475 -28.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0502 -29.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6702 -28.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3541 -28.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5355 -28.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4739 -29.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8936 -29.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6111 -30.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7585 -29.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9944 -27.5153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2649 -26.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1828 -27.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3443 -32.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1686 -32.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4689 -32.2103 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.1864 -30.9738 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.3388 -29.7678 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.6264 -28.5059 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.3356 -31.8002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4771 -29.3588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1951 -29.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1943 -30.6035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9102 -29.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6281 -29.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3426 -29.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3393 -28.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6154 -28.1136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9038 -28.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6306 -30.5989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3502 -31.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3526 -31.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0672 -30.5945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 22 1 1
5 6 1 0
10 23 1 1
14 24 1 6
9 12 1 0
18 25 1 1
10 14 1 0
21 26 1 6
13 11 1 0
26 27 2 0
11 12 1 0
26 28 1 0
13 14 1 0
3 29 1 0
1 2 1 0
3 30 1 0
1 4 1 0
6 31 1 6
2 3 1 0
9 32 1 6
5 9 1 0
17 33 1 6
13 17 1 0
13 34 1 1
14 15 1 0
2 35 1 1
15 16 1 0
25 36 1 0
16 18 1 0
36 37 1 0
37 39 1 0
17 18 1 0
37 38 2 0
6 7 1 0
7 8 1 0
39 40 2 0
8 10 1 0
40 41 1 0
9 10 1 0
41 42 2 0
3 6 1 0
42 43 1 0
18 19 1 0
43 44 2 0
44 39 1 0
19 20 1 0
40 45 1 0
20 21 1 0
45 46 1 0
21 17 1 0
46 47 1 0
5 4 1 0
46 48 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.89Molecular Weight (Monoisotopic): 603.4288AlogP: 8.82#Rotatable Bonds: 5Polar Surface Area: 75.63Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.95CX Basic pKa: ┄CX LogP: 8.55CX LogD: 8.55Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.26Np Likeness Score: 2.04
References 1. Pohjala L, Alakurtti S, Ahola T, Yli-Kauhaluoma J, Tammela P.. (2009) Betulin-derived compounds as inhibitors of alphavirus replication., 72 (11): [PMID:19839605 ] [10.1021/np9003245 ]