The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(2-indolo[1,2-c]quinazolin-6-ylphenyl)indolo[1,2-c]quinazoline ID: ALA1076886
PubChem CID: 45276939
Max Phase: Preclinical
Molecular Formula: C36H22N4
Molecular Weight: 510.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(-c2nc3ccccc3c3cc4ccccc4n23)c(-c2nc3ccccc3c3cc4ccccc4n23)c1
Standard InChI: InChI=1S/C36H22N4/c1-9-19-31-23(11-1)21-33-27-15-5-7-17-29(27)37-35(39(31)33)25-13-3-4-14-26(25)36-38-30-18-8-6-16-28(30)34-22-24-12-2-10-20-32(24)40(34)36/h1-22H
Standard InChI Key: BURPIXNECTYUED-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 48 0 0 0 0 0 0 0 0999 V2000
13.6827 -20.1236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2702 -19.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6827 -18.6920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5076 -18.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9201 -19.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7450 -19.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1575 -20.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7450 -20.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9201 -20.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5076 -20.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7647 -17.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0951 -17.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0103 -16.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2559 -16.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5905 -16.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6753 -17.5739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4256 -17.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4452 -19.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0328 -20.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2078 -20.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7953 -19.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2078 -18.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0328 -18.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2702 -20.8352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4452 -20.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0328 -21.5511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4452 -22.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2702 -22.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6827 -22.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5076 -22.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9201 -22.2668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5076 -21.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6827 -21.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8922 -22.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1378 -22.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3876 -22.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7180 -22.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8070 -21.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5573 -21.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2268 -21.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
3 17 1 0
4 11 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
18 23 2 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
24 33 1 0
28 33 2 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
35 40 2 0
26 40 1 0
27 34 2 0
19 25 1 0
2 18 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.60Molecular Weight (Monoisotopic): 510.1844AlogP: 8.93#Rotatable Bonds: 2Polar Surface Area: 34.60Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.04CX LogP: 7.69CX LogD: 7.69Aromatic Rings: 9Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: -0.26
References 1. Rohini R, Muralidhar Reddy P, Shanker K, Hu A, Ravinder V.. (2010) Antimicrobial study of newly synthesized 6-substituted indolo[1,2-c]quinazolines., 45 (3): [PMID:20005020 ] [10.1016/j.ejmech.2009.11.038 ]