The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,7-Bis-[(4,4-di-O-decanoyl)3-methoxy phenyl]-1,6-heptadiene-3,5-dione ID: ALA1077033
PubChem CID: 46866178
Max Phase: Preclinical
Molecular Formula: C41H56O8
Molecular Weight: 676.89
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCC(=O)Oc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)CCCCCCCCC)c(OC)c2)cc1OC
Standard InChI: InChI=1S/C41H56O8/c1-5-7-9-11-13-15-17-19-40(44)48-36-27-23-32(29-38(36)46-3)21-25-34(42)31-35(43)26-22-33-24-28-37(39(30-33)47-4)49-41(45)20-18-16-14-12-10-8-6-2/h21-30H,5-20,31H2,1-4H3/b25-21+,26-22+
Standard InChI Key: ORQPYPZOTHSPAT-CDTUYSNOSA-N
Molfile:
RDKit 2D
49 50 0 0 0 0 0 0 0 0999 V2000
2.9000 -7.5959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1873 -7.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1907 -6.3528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6198 -7.1890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6187 -6.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3330 -7.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0550 -7.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0519 -6.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3310 -5.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7623 -5.9348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4816 -6.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1966 -5.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9157 -6.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1926 -5.1004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6308 -5.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3500 -6.3331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6267 -5.0934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0651 -5.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7797 -6.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7799 -7.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4981 -7.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2143 -7.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2075 -6.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4886 -5.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9211 -5.8898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9012 -5.9429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9339 -7.5503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9141 -5.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6461 -7.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6433 -6.3070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9005 -5.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4734 -7.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4748 -8.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7632 -8.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7645 -9.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0530 -10.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0543 -10.8885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6526 -11.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6513 -12.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3629 -12.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3572 -7.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3583 -8.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0710 -8.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0721 -9.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7848 -10.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7859 -10.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4941 -11.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4952 -12.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2078 -12.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24 19 1 0
11 12 1 0
23 25 1 0
1 2 1 0
5 26 1 0
12 13 1 0
22 27 1 0
6 7 2 0
25 28 1 0
12 14 2 0
27 29 1 0
1 4 1 0
29 30 2 0
13 15 1 0
26 31 1 0
7 8 1 0
2 32 1 0
15 16 1 0
32 33 1 0
33 34 1 0
15 17 2 0
34 35 1 0
8 9 2 0
35 36 1 0
16 18 2 0
36 37 1 0
9 5 1 0
37 38 1 0
18 19 1 0
38 39 1 0
5 4 2 0
39 40 1 0
19 20 2 0
29 41 1 0
8 10 1 0
41 42 1 0
20 21 1 0
42 43 1 0
2 3 2 0
43 44 1 0
21 22 2 0
44 45 1 0
10 11 2 0
45 46 1 0
22 23 1 0
46 47 1 0
4 6 1 0
47 48 1 0
23 24 2 0
48 49 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 676.89Molecular Weight (Monoisotopic): 676.3975AlogP: 10.05#Rotatable Bonds: 26Polar Surface Area: 105.20Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.63CX Basic pKa: ┄CX LogP: 11.57CX LogD: 11.57Aromatic Rings: 2Heavy Atoms: 49QED Weighted: 0.03Np Likeness Score: 0.32
References 1. Singh RK, Rai D, Yadav D, Bhargava A, Balzarini J, De Clercq E.. (2010) Synthesis, antibacterial and antiviral properties of curcumin bioconjugates bearing dipeptide, fatty acids and folic acid., 45 (3): [PMID:20034711 ] [10.1016/j.ejmech.2009.12.002 ]