The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-Benzylidene-4-oxo-2-thioxothiazolidin-3-ylamino)-6-(2,4-dihydroxyphenyl)-4-methyl-N-(3-nitrophenyl)-1,6-dihydropyrimidine-5-carboxamide ID: ALA1077086
Max Phase: Preclinical
Molecular Formula: C28H22N6O6S2
Molecular Weight: 602.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2cccc([N+](=O)[O-])c2)C(c2ccc(O)cc2O)NC(NN2C(=O)/C(=C\c3ccccc3)SC2=S)=N1
Standard InChI: InChI=1S/C28H22N6O6S2/c1-15-23(25(37)30-17-8-5-9-18(13-17)34(39)40)24(20-11-10-19(35)14-21(20)36)31-27(29-15)32-33-26(38)22(42-28(33)41)12-16-6-3-2-4-7-16/h2-14,24,35-36H,1H3,(H,30,37)(H2,29,31,32)/b22-12+
Standard InChI Key: CJMLIHLVNSBIDD-WSDLNYQXSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
10.3069 -21.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3057 -22.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0206 -22.5610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7370 -22.1477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7341 -21.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0188 -20.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0223 -23.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3060 -23.7956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3055 -24.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0204 -25.0333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7373 -24.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7344 -23.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0163 -20.0830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5909 -22.5601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4532 -25.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4478 -23.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1633 -23.7901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4457 -22.5544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8767 -23.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5902 -23.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3032 -23.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3016 -22.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5810 -22.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8710 -22.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5767 -21.3121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8597 -20.9039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2887 -20.8953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5907 -25.0318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8769 -24.6184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6234 -23.8303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7984 -23.8257 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.5391 -24.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2038 -25.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1111 -23.1650 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.1975 -25.9224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8182 -25.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8051 -25.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0825 -26.2324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0691 -27.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7775 -27.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5008 -27.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5107 -26.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
20 21 1 0
10 11 1 0
21 22 2 0
5 6 2 0
22 23 1 0
11 12 2 0
23 24 2 0
24 19 1 0
12 7 1 0
3 7 1 0
6 1 1 0
25 26 2 0
25 27 1 0
23 25 1 0
6 13 1 0
9 28 1 0
1 2 2 0
28 29 1 0
29 30 1 0
2 14 1 0
3 4 2 0
11 15 1 0
7 8 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
12 16 1 0
30 34 2 0
33 35 2 0
16 17 1 0
32 36 2 0
8 9 1 0
36 37 1 0
16 18 2 0
37 38 2 0
4 5 1 0
38 39 1 0
17 19 1 0
39 40 2 0
9 10 2 0
40 41 1 0
19 20 2 0
41 42 2 0
42 37 1 0
M CHG 2 25 1 27 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.65Molecular Weight (Monoisotopic): 602.1042AlogP: 4.33#Rotatable Bonds: 6Polar Surface Area: 169.43Molecular Species: NEUTRALHBA: 11HBD: 5#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.63CX Basic pKa: 5.53CX LogP: 4.70CX LogD: 4.67Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.12Np Likeness Score: -1.20
References 1. Ibrahim DA, El-Metwally AM.. (2010) Design, synthesis, and biological evaluation of novel pyrimidine derivatives as CDK2 inhibitors., 45 (3): [PMID:20045222 ] [10.1016/j.ejmech.2009.12.026 ]