The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2,4-Dihydroxyphenyl)-2-(5-(furan-2-ylmethylene)-4-oxo-2-thioxothiazolidin-3-ylamino)-6-methyl-N-(3-nitrophenyl)-1,4-dihydropyrimidine-5-carboxamide ID: ALA1077107
Max Phase: Preclinical
Molecular Formula: C26H20N6O7S2
Molecular Weight: 592.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2cccc([N+](=O)[O-])c2)C(c2ccc(O)cc2O)NC(NN2C(=O)/C(=C\c3ccco3)SC2=S)=N1
Standard InChI: InChI=1S/C26H20N6O7S2/c1-13-21(23(35)28-14-4-2-5-15(10-14)32(37)38)22(18-8-7-16(33)11-19(18)34)29-25(27-13)30-31-24(36)20(41-26(31)40)12-17-6-3-9-39-17/h2-12,22,33-34H,1H3,(H,28,35)(H2,27,29,30)/b20-12+
Standard InChI Key: MIMZYJIUTJGFBJ-UDWIEESQSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
18.9069 -11.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9057 -11.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6206 -12.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3370 -11.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3341 -11.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6187 -10.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6222 -13.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9060 -13.5706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9055 -14.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6204 -14.8083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3373 -14.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3344 -13.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6163 -9.8580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1910 -12.3351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0532 -14.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0478 -13.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7633 -13.5651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0457 -12.3294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4767 -13.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1902 -13.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9032 -13.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9016 -12.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1810 -11.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4710 -12.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1767 -11.0871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4597 -10.6789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8887 -10.6703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1907 -14.8068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4769 -14.3934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2234 -13.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3984 -13.6007 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.1391 -14.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8038 -14.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7111 -12.9400 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.7975 -15.6974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4182 -14.7847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4051 -15.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7279 -16.0870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9704 -16.8756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7953 -16.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0626 -16.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19 20 2 0
2 3 1 0
20 21 1 0
10 11 1 0
21 22 2 0
5 6 2 0
22 23 1 0
11 12 2 0
23 24 2 0
24 19 1 0
12 7 1 0
3 7 1 0
6 1 1 0
25 26 2 0
25 27 1 0
23 25 1 0
6 13 1 0
9 28 1 0
1 2 2 0
28 29 1 0
29 30 1 0
2 14 1 0
3 4 2 0
11 15 1 0
7 8 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
12 16 1 0
30 34 2 0
33 35 2 0
16 17 1 0
32 36 2 0
8 9 1 0
36 37 1 0
37 38 1 0
16 18 2 0
4 5 1 0
17 19 1 0
9 10 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 37 2 0
M CHG 2 25 1 27 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 592.62Molecular Weight (Monoisotopic): 592.0835AlogP: 3.92#Rotatable Bonds: 6Polar Surface Area: 182.57Molecular Species: NEUTRALHBA: 12HBD: 5#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.63CX Basic pKa: 5.61CX LogP: 3.76CX LogD: 3.73Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.12Np Likeness Score: -1.36
References 1. Ibrahim DA, El-Metwally AM.. (2010) Design, synthesis, and biological evaluation of novel pyrimidine derivatives as CDK2 inhibitors., 45 (3): [PMID:20045222 ] [10.1016/j.ejmech.2009.12.026 ]