The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Methyl-N'-1-methyl-2-[(4-nitrophenyl)hydrazono-2-(phenylsulfonyl)ethylidene]-1-benzofuran-2-carbohydrazide ID: ALA1077408
PubChem CID: 44613590
Max Phase: Preclinical
Molecular Formula: C25H21N5O6S
Molecular Weight: 519.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=N\NC(=O)c1oc2ccccc2c1C)/C(=N/Nc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1
Standard InChI: InChI=1S/C25H21N5O6S/c1-16-21-10-6-7-11-22(21)36-23(16)24(31)28-26-17(2)25(37(34,35)20-8-4-3-5-9-20)29-27-18-12-14-19(15-13-18)30(32)33/h3-15,27H,1-2H3,(H,28,31)/b26-17+,29-25-
Standard InChI Key: ZCYHGUVNFQFHLU-KKPLQKKJSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-5.1612 0.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7774 -0.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9526 -0.7172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7231 0.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8995 0.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5127 -0.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6936 0.1208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5742 0.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3195 1.3109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4591 2.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8440 1.3274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1463 0.8870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8115 2.1517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4162 1.2711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2815 0.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0117 1.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2490 0.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7093 0.7745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4395 1.1585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1372 0.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1002 -0.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7970 -0.5463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5282 -0.1623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5582 0.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8606 1.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2287 -0.6026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9584 -0.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1973 -1.4270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0441 2.0392 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7743 2.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2417 1.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6250 2.7583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4702 1.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1999 2.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2329 3.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5302 3.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8034 3.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 18 2 0
8 9 2 0
18 19 1 0
9 5 1 0
19 20 1 0
4 1 1 0
20 21 2 0
9 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
8 11 1 0
23 24 1 0
24 25 2 0
25 20 1 0
11 12 1 0
2 3 1 0
11 13 2 0
26 27 2 0
26 28 1 0
23 26 1 0
3 6 2 0
16 29 1 0
12 14 1 0
29 30 1 0
1 2 2 0
29 31 2 0
14 15 2 0
29 32 2 0
5 4 2 0
30 33 2 0
15 16 1 0
33 34 1 0
6 7 1 0
34 35 2 0
15 17 1 0
35 36 1 0
7 8 1 0
36 37 2 0
37 30 1 0
M CHG 2 26 1 28 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.54Molecular Weight (Monoisotopic): 519.1213AlogP: 4.65#Rotatable Bonds: 7Polar Surface Area: 156.27Molecular Species: ACIDHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.15CX Basic pKa: ┄CX LogP: 5.48CX LogD: 3.74Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: -1.19
References 1. Abdel-Aziz HA, Mekawey AA.. (2009) Stereoselective synthesis and antimicrobial activity of benzofuran-based (1E)-1-(piperidin-1-yl)-N2-arylamidrazones., 44 (12): [PMID:19782439 ] [10.1016/j.ejmech.2009.09.002 ]