ID: ALA1077641
Cas Number: 38642-49-8
PubChem CID: 46882878
Max Phase: Preclinical
Molecular Formula: C30H32O12
Molecular Weight: 584.57
Molecule Type: Small molecule
Associated Items:
Synonyms: Benzoylpaeoniflorin | Benzoylpaeoniflorin|CHEMBL1077641|38642-49-8|BDBM50378694
Canonical SMILES: C[C@@]12C[C@@]3(O)O[C@@H](O1)[C@]1(COC(=O)c4ccccc4)[C@@H]3C[C@]12O[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](O)[C@H](O)[C@H]1O
Standard InChI: InChI=1S/C30H32O12/c1-27-14-29(36)19-12-30(27,28(19,26(41-27)42-29)15-38-24(35)17-10-6-3-7-11-17)40-25-22(33)21(32)20(31)18(39-25)13-37-23(34)16-8-4-2-5-9-16/h2-11,18-22,25-26,31-33,36H,12-15H2,1H3/t18-,19+,20-,21+,22-,25+,26-,27+,28+,29-,30-/m1/s1
Standard InChI Key: LATYEZNGPQKAIK-QFZPXPOBSA-N
Molfile:
RDKit 2D
44 50 0 0 0 0 0 0 0 0999 V2000
8.2403 -1.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -2.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9697 -2.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6921 -2.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6906 -1.2515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9668 -0.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9653 0.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7737 -0.6061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9690 -1.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1508 -1.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5109 -0.8354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2429 -2.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5647 -3.4102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1841 -3.3177 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.6396 -0.0911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6643 -0.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3902 -1.3078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4087 -2.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1307 -2.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8349 -2.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8126 -1.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0861 -0.8722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7050 -2.5615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1518 -3.3471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5594 -2.4870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1764 -4.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4982 -4.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4663 -3.9676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1081 -5.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4294 -5.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1403 -5.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5287 -5.3063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2052 -4.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6877 -2.9155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7331 -1.9534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8622 -0.9538 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.9134 0.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8887 1.1241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2119 -0.1337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5916 1.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5674 2.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8406 2.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1369 2.3337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1646 1.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19 20 1 0
20 21 1 0
21 22 1 0
6 8 1 0
18 23 1 6
1 9 1 0
19 24 1 1
3 9 1 0
20 25 1 6
21 11 1 1
9 10 1 0
13 26 1 0
8 10 1 0
26 27 1 0
1 11 1 6
26 28 2 0
9 12 1 1
27 29 2 0
12 13 1 0
29 30 1 0
3 14 1 6
30 31 2 0
31 32 1 0
1 2 1 0
32 33 2 0
33 27 1 0
15 16 1 0
4 34 1 6
1 6 1 0
10 35 1 0
4 35 1 0
17 16 1 1
10 36 1 1
17 18 1 0
15 37 1 0
2 3 1 0
37 38 1 0
3 4 1 0
37 39 2 0
4 5 1 0
38 40 2 0
5 6 1 0
40 41 1 0
6 7 1 6
41 42 2 0
17 22 1 0
42 43 1 0
18 19 1 0
43 44 2 0
44 38 1 0
M END| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Natural Product: Yes | Oral: No | Chemical Probe: No | Parenteral: No |
| Molecule Type: Small molecule | Topical: No | First In Class: No | Black Box: No |
| Chirality: No | Availability: No | Prodrug: No |
| MESH ID | MESH Heading | EFO IDs | EFO Terms | Max Phase for Indication | References |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Molecular Weight: 584.57 | Molecular Weight (Monoisotopic): 584.1894 | AlogP: 0.51 | #Rotatable Bonds: 8 |
| Polar Surface Area: 170.44 | Molecular Species: NEUTRAL | HBA: 12 | HBD: 4 |
| #RO5 Violations: 2 | HBA (Lipinski): 12 | HBD (Lipinski): 4 | #RO5 Violations (Lipinski): 2 |
| CX Acidic pKa: 11.54 | CX Basic pKa: ┄ | CX LogP: 2.11 | CX LogD: 2.11 |
| Aromatic Rings: 2 | Heavy Atoms: 42 | QED Weighted: 0.32 | Np Likeness Score: 1.84 |
| 1. Duan WJ, Yang JY, Chen LX, Zhang LJ, Jiang ZH, Cai XD, Zhang X, Qiu F.. (2009) Monoterpenes from Paeonia albiflora and their inhibitory activity on nitric oxide production by lipopolysaccharide-activated microglia., 72 (9): [PMID:19691309] [10.1021/np9001898] |
| 2. Ha do T, Ngoc TM, Lee I, Lee YM, Kim JS, Jung H, Lee S, Na M, Bae K.. (2009) Inhibitors of aldose reductase and formation of advanced glycation end-products in moutan cortex (Paeonia suffruticosa)., 72 (8): [PMID:19670875] [10.1021/np9002004] |
| 3. Mencherini T, Picerno P, Festa M, Russo P, Capasso A, Aquino R.. (2011) Triterpenoid constituents from the roots of Paeonia rockii ssp. rockii., 74 (10): [PMID:21954959] [10.1021/np200359v] |
| 4. Ding L, Zhao F, Chen L, Jiang Z, Liu Y, Li Z, Qiu F, Yao X.. (2012) New monoterpene glycosides from Paeonia suffruticosa Andrews and their inhibition on NO production in LPS-induced RAW 264.7 cells., 22 (23): [PMID:23067550] [10.1016/j.bmcl.2012.09.034] |
Source(1):