The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-O-succinoylgeniposide ID: ALA1077845
PubChem CID: 44255239
Max Phase: Preclinical
Molecular Formula: C21H28O13
Molecular Weight: 488.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 10-O-Succinoylgeniposide | 10-O-succinoylgeniposide|CHEMBL1077845
Canonical SMILES: COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C(COC(=O)CCC(=O)O)=CC[C@H]12
Standard InChI: InChI=1S/C21H28O13/c1-30-19(29)11-8-32-20(34-21-18(28)17(27)16(26)12(6-22)33-21)15-9(2-3-10(11)15)7-31-14(25)5-4-13(23)24/h2,8,10,12,15-18,20-22,26-28H,3-7H2,1H3,(H,23,24)/t10-,12-,15-,16-,17+,18-,20+,21+/m1/s1
Standard InChI Key: HXIKOBSBFWQXOF-NLIZERCJSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
6.5330 -0.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5786 1.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0621 0.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3717 0.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3433 -0.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8357 0.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1157 1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2500 -1.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4418 -1.1536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1419 2.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8644 2.4467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4457 2.4922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0304 -1.2783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7253 -1.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6940 -2.5342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3895 -2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1154 -2.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1459 -1.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4460 -1.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3580 -3.7858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8708 -1.3816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4766 -0.5055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8087 -3.0219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3623 1.6612 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.3340 -0.8277 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.5605 2.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0559 -4.2255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0558 -1.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2314 -1.9129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4942 -2.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1082 -3.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5466 -4.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1606 -4.7384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3708 -3.9790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8073 -0.0592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0589 -0.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7734 -0.8710 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
36 35 1 0
35 6 1 0
6 7 2 0
1 5 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
1 8 1 0
16 20 1 1
18 21 1 1
8 9 1 0
19 22 1 6
4 2 1 0
17 23 1 6
7 10 1 0
4 24 1 1
2 3 1 0
5 25 1 1
10 11 1 0
11 26 1 0
3 1 2 0
20 27 1 0
10 12 2 0
9 28 1 0
4 5 1 0
28 29 2 0
36 13 1 0
28 30 1 0
4 7 1 0
30 31 1 0
14 13 1 1
31 32 1 0
14 15 1 0
32 33 1 0
5 36 1 0
32 34 2 0
36 37 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.44Molecular Weight (Monoisotopic): 488.1530AlogP: -1.81#Rotatable Bonds: 9Polar Surface Area: 198.51Molecular Species: ACIDHBA: 12HBD: 5#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.97CX Basic pKa: ┄CX LogP: -1.95CX LogD: -5.12Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: 2.19
References 1. Yu Y, Xie ZL, Gao H, Ma WW, Dai Y, Wang Y, Zhong Y, Yao XS.. (2009) Bioactive iridoid glucosides from the fruit of Gardenia jasminoides., 72 (8): [PMID:19650637 ] [10.1021/np900176q ]