10-O-succinoylgeniposide

ID: ALA1077845

PubChem CID: 44255239

Max Phase: Preclinical

Molecular Formula: C21H28O13

Molecular Weight: 488.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 10-O-Succinoylgeniposide | 10-O-succinoylgeniposide|CHEMBL1077845

Canonical SMILES:  COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C(COC(=O)CCC(=O)O)=CC[C@H]12

Standard InChI:  InChI=1S/C21H28O13/c1-30-19(29)11-8-32-20(34-21-18(28)17(27)16(26)12(6-22)33-21)15-9(2-3-10(11)15)7-31-14(25)5-4-13(23)24/h2,8,10,12,15-18,20-22,26-28H,3-7H2,1H3,(H,23,24)/t10-,12-,15-,16-,17+,18-,20+,21+/m1/s1

Standard InChI Key:  HXIKOBSBFWQXOF-NLIZERCJSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    6.5330   -0.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5786    1.1268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    0.4573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3717    0.8378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3433   -0.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8357    0.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1157    1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2500   -1.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4418   -1.1536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1419    2.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8644    2.4467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4457    2.4922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0304   -1.2783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7253   -1.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6940   -2.5342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3895   -2.9663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1154   -2.5871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1459   -1.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4460   -1.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3580   -3.7858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8708   -1.3816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4766   -0.5055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8087   -3.0219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3623    1.6612    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3340   -0.8277    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5605    2.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0559   -4.2255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0558   -1.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2314   -1.9129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4942   -2.5814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1082   -3.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5466   -4.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1606   -4.7384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3708   -3.9790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8073   -0.0592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0589   -0.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7734   -0.8710    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 36 35  1  0
 35  6  1  0
  6  7  2  0
  1  5  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  1  8  1  0
 16 20  1  1
 18 21  1  1
  8  9  1  0
 19 22  1  6
  4  2  1  0
 17 23  1  6
  7 10  1  0
  4 24  1  1
  2  3  1  0
  5 25  1  1
 10 11  1  0
 11 26  1  0
  3  1  2  0
 20 27  1  0
 10 12  2  0
  9 28  1  0
  4  5  1  0
 28 29  2  0
 36 13  1  0
 28 30  1  0
  4  7  1  0
 30 31  1  0
 14 13  1  1
 31 32  1  0
 14 15  1  0
 32 33  1  0
  5 36  1  0
 32 34  2  0
 36 37  1  6
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Drosophila (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.44Molecular Weight (Monoisotopic): 488.1530AlogP: -1.81#Rotatable Bonds: 9
Polar Surface Area: 198.51Molecular Species: ACIDHBA: 12HBD: 5
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.97CX Basic pKa: CX LogP: -1.95CX LogD: -5.12
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: 2.19

References

1. Yu Y, Xie ZL, Gao H, Ma WW, Dai Y, Wang Y, Zhong Y, Yao XS..  (2009)  Bioactive iridoid glucosides from the fruit of Gardenia jasminoides.,  72  (8): [PMID:19650637] [10.1021/np900176q]

Source