The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-Ethylphenyl)-3-(4-(5-(4-ethylphenyl)-1,4,2-dioxazol-3-yl)phenyl)-1,4,2-dioxazole ID: ALA1078149
PubChem CID: 44516436
Max Phase: Preclinical
Molecular Formula: C26H24N2O4
Molecular Weight: 428.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(C2ON=C(c3ccc(C4=NOC(c5ccc(CC)cc5)O4)cc3)O2)cc1
Standard InChI: InChI=1S/C26H24N2O4/c1-3-17-5-9-21(10-6-17)25-29-23(27-31-25)19-13-15-20(16-14-19)24-28-32-26(30-24)22-11-7-18(4-2)8-12-22/h5-16,25-26H,3-4H2,1-2H3
Standard InChI Key: YFAQTTPVQAVUSI-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
16.4826 -17.8794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6578 -17.8560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4266 -17.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1090 -16.6003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7598 -17.1060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7094 -16.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9961 -17.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2786 -16.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2743 -15.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9875 -15.4214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7050 -15.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8205 -14.2701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6055 -14.5280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6055 -15.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8205 -15.6069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3379 -14.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5127 -14.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0980 -15.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2729 -15.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8623 -14.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2729 -14.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0980 -14.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4815 -16.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4973 -15.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2190 -15.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9248 -15.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9106 -16.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1890 -17.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6434 -15.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0413 -14.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6308 -14.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6586 -14.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
12 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
16 17 1 0
9 14 1 0
3 6 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
5 23 1 0
26 29 1 0
1 2 1 0
20 30 1 0
2 3 2 0
30 31 1 0
3 4 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.49Molecular Weight (Monoisotopic): 428.1736AlogP: 5.63#Rotatable Bonds: 6Polar Surface Area: 61.64Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.13CX LogP: 7.96CX LogD: 7.96Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -0.17
References 1. Iqbal PF, Parveen H, Bhat AR, Hayat F, Azam A.. (2009) Synthesis, characterization, antiamoebic activity and toxicity of novel bisdioxazole derivatives., 44 (11): [PMID:19589625 ] [10.1016/j.ejmech.2009.06.016 ]