The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-O-butylpaeoniflorin ID: ALA1078184
PubChem CID: 44253994
Max Phase: Preclinical
Molecular Formula: C27H36O11
Molecular Weight: 536.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: 4-O-Butylpaeoniflorin | 4-O-butylpaeoniflorin|CHEMBL1078184|BDBM50310708
Canonical SMILES: CCCCO[C@]12C[C@]3(C)OC(O1)[C@]1(COC(=O)c4ccccc4)[C@@H]2C[C@@]31O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Standard InChI: InChI=1S/C27H36O11/c1-3-4-10-34-26-13-24(2)27(36-22-20(31)19(30)18(29)16(12-28)35-22)11-17(26)25(27,23(37-24)38-26)14-33-21(32)15-8-6-5-7-9-15/h5-9,16-20,22-23,28-31H,3-4,10-14H2,1-2H3/t16-,17+,18-,19+,20-,22+,23?,24+,25+,26-,27-/m1/s1
Standard InChI Key: WZGDJBIFNLWZEF-POZPPLBNSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
12.2448 2.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2448 1.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9796 0.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7195 1.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9796 2.5873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5305 2.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5285 3.3934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4331 2.5690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4320 0.8927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9784 0.0609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5316 0.8938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1573 2.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1434 1.3549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5679 1.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6183 2.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8690 2.5829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8591 1.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8591 0.9455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9486 -0.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1232 -0.1751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7104 -0.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8849 -0.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1232 -1.6015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4823 -0.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6577 -0.1733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2440 -0.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6615 -1.6027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4847 -1.5993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8651 0.1201 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.8591 3.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5746 3.0017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2750 1.7560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2450 2.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5596 0.5153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2685 0.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2602 -0.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9741 -1.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9659 -1.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7195 2.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7195 2.9820 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
2 3 1 0
17 19 1 1
4 9 1 6
20 19 1 0
3 4 1 0
20 21 1 0
3 10 1 1
21 22 1 0
4 39 1 0
21 23 2 0
2 11 1 6
22 24 2 0
39 5 1 0
24 25 1 0
12 13 1 0
25 26 2 0
26 27 1 0
1 6 1 1
27 28 2 0
28 22 1 0
1 2 1 0
18 29 1 6
6 7 1 0
16 30 1 6
12 8 1 6
12 16 1 0
16 31 1 0
13 18 1 0
14 32 1 0
18 14 1 0
31 33 1 0
33 32 1 0
17 33 1 0
14 15 1 0
14 34 1 6
15 16 1 0
34 35 1 0
1 5 1 0
35 36 1 0
12 17 1 0
36 37 1 0
39 8 1 0
37 38 1 0
39 40 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.57Molecular Weight (Monoisotopic): 536.2258AlogP: 0.47#Rotatable Bonds: 10Polar Surface Area: 153.37Molecular Species: NEUTRALHBA: 11HBD: 4#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.21CX Basic pKa: ┄CX LogP: 1.58CX LogD: 1.58Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: 2.10
References 1. Ha do T, Ngoc TM, Lee I, Lee YM, Kim JS, Jung H, Lee S, Na M, Bae K.. (2009) Inhibitors of aldose reductase and formation of advanced glycation end-products in moutan cortex (Paeonia suffruticosa)., 72 (8): [PMID:19670875 ] [10.1021/np9002004 ] 2. Ding L, Zhao F, Chen L, Jiang Z, Liu Y, Li Z, Qiu F, Yao X.. (2012) New monoterpene glycosides from Paeonia suffruticosa Andrews and their inhibition on NO production in LPS-induced RAW 264.7 cells., 22 (23): [PMID:23067550 ] [10.1016/j.bmcl.2012.09.034 ]