The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-2-(1-(3-ethoxy-4-methoxybenzyl)piperidin-4-ylamino)benzo[d]oxazole-6-sulfonamide ID: ALA1078240
PubChem CID: 46882664
Max Phase: Preclinical
Molecular Formula: C22H27ClN4O5S
Molecular Weight: 495.00
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cc(CN2CCC(Nc3nc4cc(Cl)c(S(N)(=O)=O)cc4o3)CC2)ccc1OC
Standard InChI: InChI=1S/C22H27ClN4O5S/c1-3-31-20-10-14(4-5-18(20)30-2)13-27-8-6-15(7-9-27)25-22-26-17-11-16(23)21(33(24,28)29)12-19(17)32-22/h4-5,10-12,15H,3,6-9,13H2,1-2H3,(H,25,26)(H2,24,28,29)
Standard InChI Key: GWSJPOPJXLJSLF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.0606 2.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0619 1.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3449 0.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3469 2.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6340 2.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6336 1.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8476 0.9539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3642 1.6202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8488 2.2855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4601 1.6211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8730 0.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4617 0.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8708 -0.5157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6954 -0.5195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1092 0.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6984 0.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1053 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9296 -1.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3413 -1.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1648 -1.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5755 -1.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1653 -0.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3387 -0.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5769 0.1889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4012 0.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8128 0.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3998 -1.2406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8153 -1.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7743 0.7903 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.7727 2.4407 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.4891 2.0283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3658 3.1598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1901 3.1598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14 15 1 0
15 16 1 0
6 7 1 0
14 17 1 0
7 8 2 0
17 18 1 0
8 9 1 0
18 19 2 0
9 5 1 0
19 20 1 0
4 1 1 0
20 21 2 0
8 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
23 18 1 0
10 11 1 0
22 24 1 0
11 12 1 0
24 25 1 0
25 26 1 0
2 3 1 0
21 27 1 0
3 6 2 0
27 28 1 0
1 2 2 0
2 29 1 0
5 4 2 0
1 30 1 0
11 16 1 0
30 31 1 0
12 13 1 0
30 32 2 0
13 14 1 0
30 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.00Molecular Weight (Monoisotopic): 494.1391AlogP: 3.61#Rotatable Bonds: 8Polar Surface Area: 119.92Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.76CX Basic pKa: 7.52CX LogP: 2.29CX LogD: 2.08Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -1.64
References 1. Martin RE, Mohr P, Maerki HP, Guba W, Kuratli C, Gavelle O, Binggeli A, Bendels S, Alvarez-Sánchez R, Alker A, Polonchuk L, Christ AD.. (2009) Benzoxazole piperidines as selective and potent somatostatin receptor subtype 5 antagonists., 19 (21): [PMID:19786348 ] [10.1016/j.bmcl.2009.09.024 ]