The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6'-O-trans-p-coumaroylgeniposide ID: ALA1078425
PubChem CID: 44255238
Max Phase: Preclinical
Molecular Formula: C26H30O12
Molecular Weight: 534.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](COC(=O)/C=C/c3ccc(O)cc3)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C(CO)=CC[C@H]12
Standard InChI: InChI=1S/C26H30O12/c1-34-24(33)17-11-36-25(20-14(10-27)5-8-16(17)20)38-26-23(32)22(31)21(30)18(37-26)12-35-19(29)9-4-13-2-6-15(28)7-3-13/h2-7,9,11,16,18,20-23,25-28,30-32H,8,10,12H2,1H3/b9-4+/t16-,18-,20-,21-,22+,23-,25+,26+/m1/s1
Standard InChI Key: IVYAOUHUAWZJDB-UZOBGTHZSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
-2.1806 -0.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1351 1.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6547 0.3431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3399 0.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3682 -0.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1290 0.6783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5935 1.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4626 -1.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2726 -1.2719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5674 1.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1574 2.3403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2661 2.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6786 -1.3964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0189 -1.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0123 -2.6531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6858 -3.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4093 -2.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4398 -1.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7419 -1.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6495 -3.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1671 -1.4993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7725 -0.6213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1051 -3.1440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3491 1.5527 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.3773 -0.9425 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.8562 1.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3499 -4.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3182 -5.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6071 -5.6023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0979 -5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8043 -5.6725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8060 -6.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5173 -6.8702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2267 -6.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2250 -5.7429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5139 -5.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9361 -6.9448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0230 -5.5320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1007 -0.1718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6501 -0.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0644 -0.9871 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
1 8 1 0
16 20 1 1
18 21 1 1
8 9 1 0
19 22 1 6
4 2 1 0
17 23 1 6
7 10 1 0
4 24 1 1
2 3 1 0
5 25 1 1
10 11 1 0
11 26 1 0
3 1 2 0
20 27 1 0
10 12 2 0
27 28 1 0
4 5 1 0
40 13 1 0
4 7 1 0
14 13 1 1
14 15 1 0
5 40 1 0
40 39 1 0
39 6 1 0
6 7 2 0
1 5 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
31 36 2 0
34 37 1 0
28 38 2 0
40 41 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.51Molecular Weight (Monoisotopic): 534.1737AlogP: -0.26#Rotatable Bonds: 8Polar Surface Area: 181.44Molecular Species: NEUTRALHBA: 12HBD: 5#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.40CX Basic pKa: ┄CX LogP: 0.52CX LogD: 0.51Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.17Np Likeness Score: 2.23
References 1. Yu Y, Xie ZL, Gao H, Ma WW, Dai Y, Wang Y, Zhong Y, Yao XS.. (2009) Bioactive iridoid glucosides from the fruit of Gardenia jasminoides., 72 (8): [PMID:19650637 ] [10.1021/np900176q ]