The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-O-acetylgeniposide ID: ALA1078435
PubChem CID: 6324916
Max Phase: Preclinical
Molecular Formula: C19H26O11
Molecular Weight: 430.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 10-O-Acetylgeniposide | 10-O-Acetylgeniposide|CHEMBL1078435
Canonical SMILES: COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C(COC(C)=O)=CC[C@H]12
Standard InChI: InChI=1S/C19H26O11/c1-8(21)27-6-9-3-4-10-11(17(25)26-2)7-28-18(13(9)10)30-19-16(24)15(23)14(22)12(5-20)29-19/h3,7,10,12-16,18-20,22-24H,4-6H2,1-2H3/t10-,12-,13-,14-,15+,16-,18+,19+/m1/s1
Standard InChI Key: LOXQKSBAJJTUOX-BZDYRZRUSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
15.3892 -12.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4346 -11.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9200 -11.7734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2247 -11.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1965 -12.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6834 -11.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9659 -10.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1073 -13.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3020 -13.3782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9920 -10.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7118 -9.7914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2984 -9.7461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8810 -13.5024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5734 -13.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5422 -14.7537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2351 -15.1842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9582 -14.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9887 -13.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2913 -13.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2035 -16.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7108 -13.6054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3218 -12.7325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6489 -15.2396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2155 -10.5739 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.1873 -13.0535 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.4054 -10.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8990 -16.4387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7736 -12.7489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0507 -11.9767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9605 -12.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6551 -12.2879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9094 -12.6858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6239 -13.0983 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4 7 1 0
14 13 1 1
14 15 1 0
5 32 1 0
32 31 1 0
31 6 1 0
6 7 2 0
1 5 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
1 8 1 0
16 20 1 1
18 21 1 1
8 9 1 0
19 22 1 6
4 2 1 0
17 23 1 6
7 10 1 0
4 24 1 1
2 3 1 0
5 25 1 1
10 11 1 0
11 26 1 0
3 1 2 0
20 27 1 0
10 12 2 0
9 28 1 0
4 5 1 0
32 13 1 0
28 29 2 0
28 30 1 0
32 33 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.41Molecular Weight (Monoisotopic): 430.1475AlogP: -1.66#Rotatable Bonds: 6Polar Surface Area: 161.21Molecular Species: NEUTRALHBA: 11HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.21CX Basic pKa: ┄CX LogP: -1.77CX LogD: -1.77Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.28Np Likeness Score: 2.59
References 1. Yu Y, Xie ZL, Gao H, Ma WW, Dai Y, Wang Y, Zhong Y, Yao XS.. (2009) Bioactive iridoid glucosides from the fruit of Gardenia jasminoides., 72 (8): [PMID:19650637 ] [10.1021/np900176q ]