10-O-acetylgeniposide

ID: ALA1078435

PubChem CID: 6324916

Max Phase: Preclinical

Molecular Formula: C19H26O11

Molecular Weight: 430.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 10-O-Acetylgeniposide | 10-O-Acetylgeniposide|CHEMBL1078435

Canonical SMILES:  COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C(COC(C)=O)=CC[C@H]12

Standard InChI:  InChI=1S/C19H26O11/c1-8(21)27-6-9-3-4-10-11(17(25)26-2)7-28-18(13(9)10)30-19-16(24)15(23)14(22)12(5-20)29-19/h3,7,10,12-16,18-20,22-24H,4-6H2,1-2H3/t10-,12-,13-,14-,15+,16-,18+,19+/m1/s1

Standard InChI Key:  LOXQKSBAJJTUOX-BZDYRZRUSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   15.3892  -12.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4346  -11.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9200  -11.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2247  -11.3942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1965  -12.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6834  -11.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9659  -10.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1073  -13.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3020  -13.3782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9920  -10.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7118   -9.7914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2984   -9.7461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8810  -13.5024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5734  -13.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5422  -14.7537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2351  -15.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9582  -14.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9887  -13.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2913  -13.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2035  -16.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7108  -13.6054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3218  -12.7325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6489  -15.2396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2155  -10.5739    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.1873  -13.0535    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.4054  -10.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8990  -16.4387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7736  -12.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0507  -11.9767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9605  -12.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6551  -12.2879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9094  -12.6858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6239  -13.0983    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  4  7  1  0
 14 13  1  1
 14 15  1  0
  5 32  1  0
 32 31  1  0
 31  6  1  0
  6  7  2  0
  1  5  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  1  8  1  0
 16 20  1  1
 18 21  1  1
  8  9  1  0
 19 22  1  6
  4  2  1  0
 17 23  1  6
  7 10  1  0
  4 24  1  1
  2  3  1  0
  5 25  1  1
 10 11  1  0
 11 26  1  0
  3  1  2  0
 20 27  1  0
 10 12  2  0
  9 28  1  0
  4  5  1  0
 32 13  1  0
 28 29  2  0
 28 30  1  0
 32 33  1  6
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Drosophila (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.41Molecular Weight (Monoisotopic): 430.1475AlogP: -1.66#Rotatable Bonds: 6
Polar Surface Area: 161.21Molecular Species: NEUTRALHBA: 11HBD: 4
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.21CX Basic pKa: CX LogP: -1.77CX LogD: -1.77
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.28Np Likeness Score: 2.59

References

1. Yu Y, Xie ZL, Gao H, Ma WW, Dai Y, Wang Y, Zhong Y, Yao XS..  (2009)  Bioactive iridoid glucosides from the fruit of Gardenia jasminoides.,  72  (8): [PMID:19650637] [10.1021/np900176q]

Source