The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(3-ethoxy-4-methoxybenzyl)piperidin-4-ylamino)-N,N-dimethylbenzo[d]oxazole-5-sulfonamide ID: ALA1078528
PubChem CID: 46882622
Max Phase: Preclinical
Molecular Formula: C24H32N4O5S
Molecular Weight: 488.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cc(CN2CCC(Nc3nc4cc(S(=O)(=O)N(C)C)ccc4o3)CC2)ccc1OC
Standard InChI: InChI=1S/C24H32N4O5S/c1-5-32-23-14-17(6-8-22(23)31-4)16-28-12-10-18(11-13-28)25-24-26-20-15-19(7-9-21(20)33-24)34(29,30)27(2)3/h6-9,14-15,18H,5,10-13,16H2,1-4H3,(H,25,26)
Standard InChI Key: RMRBRTBXJMVAPE-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
9.2966 -26.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2954 -27.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0128 -28.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0108 -26.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7243 -26.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7246 -27.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5112 -28.0627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9995 -27.3959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5100 -26.7303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8244 -27.3951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2376 -28.1072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8261 -28.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2353 -29.5334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0606 -29.5373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4747 -28.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0636 -28.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4709 -30.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2956 -30.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7031 -30.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5271 -30.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9427 -30.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5277 -29.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7051 -29.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9395 -28.8282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7644 -28.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1763 -28.1102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7676 -30.2634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1788 -30.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5825 -28.2265 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.1617 -28.9348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9865 -28.9348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8638 -27.8121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8624 -26.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1475 -28.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
6 7 1 0
14 17 1 0
7 8 2 0
17 18 1 0
8 9 1 0
18 19 2 0
9 5 1 0
19 20 1 0
4 1 1 0
20 21 2 0
8 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
23 18 1 0
10 11 1 0
22 24 1 0
11 12 1 0
24 25 1 0
25 26 1 0
2 3 1 0
21 27 1 0
3 6 2 0
27 28 1 0
1 2 2 0
2 29 1 0
5 4 2 0
29 30 2 0
11 16 1 0
29 31 2 0
12 13 1 0
29 32 1 0
13 14 1 0
32 33 1 0
14 15 1 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.61Molecular Weight (Monoisotopic): 488.2093AlogP: 3.56#Rotatable Bonds: 9Polar Surface Area: 97.14Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.49CX Basic pKa: 7.54CX LogP: 2.32CX LogD: 1.94Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -1.72
References 1. Martin RE, Mohr P, Maerki HP, Guba W, Kuratli C, Gavelle O, Binggeli A, Bendels S, Alvarez-Sánchez R, Alker A, Polonchuk L, Christ AD.. (2009) Benzoxazole piperidines as selective and potent somatostatin receptor subtype 5 antagonists., 19 (21): [PMID:19786348 ] [10.1016/j.bmcl.2009.09.024 ]