The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1E)-N-ethyl-N'-[(1E)-1-(ethylamino)propylidene]propanehydrazonamide; 2-hydroxypropane-1,2,3-tricarboxylic acid ID: ALA107859
PubChem CID: 23167693
Max Phase: Preclinical
Molecular Formula: C16H30N4O7
Molecular Weight: 198.31
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC/N=C(/CC)NN/C(CC)=N/CC.O=C(O)CC(O)(CC(=O)O)C(=O)O
Standard InChI: InChI=1S/C10H22N4.C6H8O7/c1-5-9(11-7-3)13-14-10(6-2)12-8-4;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-8H2,1-4H3,(H,11,13)(H,12,14);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
Standard InChI Key: DWAQWFPHOCDAKV-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 25 0 0 0 0 0 0 0 0999 V2000
1.5542 2.4458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8417 2.0333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 2.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2667 2.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9792 2.4458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5958 2.0333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2667 1.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 3.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6917 2.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5958 1.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5958 3.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9792 0.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 2.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 0.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6000 -2.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1875 -2.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8875 -1.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 -1.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 -2.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6000 -3.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5917 -0.6417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1792 -4.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5458 -1.6625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3125 -2.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8375 -1.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4250 -3.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 -2.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 1 0
5 4 2 0
6 3 2 0
7 4 1 0
8 3 1 0
9 5 1 0
10 6 1 0
11 8 1 0
12 7 1 0
13 9 1 0
14 10 1 0
16 15 1 0
17 15 1 0
18 15 1 0
19 17 1 0
20 16 1 0
21 18 2 0
22 20 2 0
23 19 2 0
24 15 1 0
25 18 1 0
26 20 1 0
27 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 198.31Molecular Weight (Monoisotopic): 198.1844AlogP: 1.74#Rotatable Bonds: 4Polar Surface Area: 48.78Molecular Species: BASEHBA: 2HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.77CX LogP: 1.21CX LogD: -2.38Aromatic Rings: ┄Heavy Atoms: 14QED Weighted: 0.41Np Likeness Score: -0.41
References 1. Srivastava SK, Chauhan PM, Bhaduri AP, Murthy PK, Chatterjee RK.. (2000) Secondary amines as new pharmacophores for macrofilaricidal drug design., 10 (4): [PMID:10714488 ] [10.1016/s0960-894x(99)00687-3 ]