3-benzyl-4-butyl-8-(1-(2,6-dimethylbenzoyl)piperidin-4-yl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one

ID: ALA1078647

PubChem CID: 25057602

Max Phase: Preclinical

Molecular Formula: C32H43N3O3

Molecular Weight: 517.71

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCC1N(Cc2ccccc2)C(=O)OC12CCN(C1CCN(C(=O)c3c(C)cccc3C)CC1)CC2

Standard InChI:  InChI=1S/C32H43N3O3/c1-4-5-14-28-32(38-31(37)35(28)23-26-12-7-6-8-13-26)17-21-33(22-18-32)27-15-19-34(20-16-27)30(36)29-24(2)10-9-11-25(29)3/h6-13,27-28H,4-5,14-23H2,1-3H3

Standard InChI Key:  OVAAQBKFWMSBDM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -2.0017   -9.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4748   -8.5565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2706   -8.7953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2894   -9.6260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5053   -9.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7444   -8.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5691   -8.5445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6105   -9.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7858   -9.9935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3504   -9.2907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4720   -9.3160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8633  -10.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6844  -10.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1203   -9.3672    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7289   -8.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9017   -8.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9269   -8.2954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9676  -10.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9608  -10.5189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2252  -11.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6807  -11.9201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9452  -12.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7136   -9.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7307   -8.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4492   -8.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1589   -8.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1485   -9.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4201  -10.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9449   -9.3931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3796   -8.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3347  -10.1202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2049   -8.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6395   -8.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2497   -7.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4207   -7.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9898   -7.9703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1651   -7.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5932   -9.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4 18  1  0
  7  1  1  0
  5 19  1  0
  1  8  1  0
 19 20  1  0
  8  9  1  0
 20 21  1  0
  9 10  1  0
 21 22  1  0
 11 12  1  0
 18 23  1  0
 23 24  2  0
  5  1  1  0
  6  7  1  0
  1  2  1  0
  2  3  1  0
 23 28  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
  3  4  1  0
 14 29  1  0
 11 16  1  0
 29 30  1  0
 12 13  1  0
 29 31  2  0
 13 14  1  0
 30 32  2  0
 14 15  1  0
 32 33  1  0
 15 16  1  0
 33 34  2  0
 10 11  1  0
 34 35  1  0
  4  5  1  0
 35 36  2  0
 36 30  1  0
  3 17  2  0
 36 37  1  0
  6 10  1  0
 32 38  1  0
M  END

Associated Targets(Human)

CCR5 Tclin C-C chemokine receptor type 5 (5640 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 517.71Molecular Weight (Monoisotopic): 517.3304AlogP: 5.95#Rotatable Bonds: 7
Polar Surface Area: 53.09Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.97CX LogP: 5.50CX LogD: 3.93
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.46Np Likeness Score: -0.49

References

1. Rotstein DM, Gabriel SD, Makra F, Filonova L, Gleason S, Brotherton-Pleiss C, Setti LQ, Trejo-Martin A, Lee EK, Sankuratri S, Ji C, Derosier A, Dioszegi M, Heilek G, Jekle A, Berry P, Weller P, Mau CI..  (2009)  Spiropiperidine CCR5 antagonists.,  19  (18): [PMID:19674898] [10.1016/j.bmcl.2009.07.122]

Source