3-(cyclohexylmethyl)-8-(1-(2,6-dimethylbenzoyl)piperidin-4-yl)-4-propyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one

ID: ALA1078648

PubChem CID: 25057877

Max Phase: Preclinical

Molecular Formula: C31H47N3O3

Molecular Weight: 509.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC1N(CC2CCCCC2)C(=O)OC12CCN(C1CCN(C(=O)c3c(C)cccc3C)CC1)CC2

Standard InChI:  InChI=1S/C31H47N3O3/c1-4-9-27-31(37-30(36)34(27)22-25-12-6-5-7-13-25)16-20-32(21-17-31)26-14-18-33(19-15-26)29(35)28-23(2)10-8-11-24(28)3/h8,10-11,25-27H,4-7,9,12-22H2,1-3H3

Standard InChI Key:  XRWCFFSMTYOSBA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   11.9265   -9.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4535   -9.1183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6577   -9.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6390  -10.1877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4230  -10.4608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1837   -9.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3591   -9.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3177  -10.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1424  -10.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5776   -9.8524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4001   -9.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7913  -10.6051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6123  -10.6297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0481   -9.9289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6569   -9.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8297   -9.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0014   -8.8572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9608  -10.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9675  -11.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7030  -11.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2474  -12.4816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2148  -10.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1977   -9.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4792   -9.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7708   -9.5035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7854  -10.3293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5084  -10.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8727   -9.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3074   -9.2537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2625  -10.6819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1327   -9.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5672   -8.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1774   -7.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3485   -7.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9177   -8.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0930   -8.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5209  -10.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6 10  1  0
  4 18  1  0
  7  1  1  0
  5 19  1  0
  1  8  1  0
 19 20  1  0
  8  9  1  0
 20 21  1  0
  9 10  1  0
 18 22  1  0
 22 23  1  0
 11 12  1  0
  5  1  1  0
  6  7  1  0
  1  2  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
  2  3  1  0
 14 28  1  0
  3  4  1  0
 28 29  1  0
 11 16  1  0
 28 30  2  0
 12 13  1  0
 29 31  2  0
 13 14  1  0
 31 32  1  0
 14 15  1  0
 32 33  2  0
 15 16  1  0
 33 34  1  0
 10 11  1  0
 34 35  2  0
 35 29  1  0
  4  5  1  0
 35 36  1  0
  3 17  2  0
 31 37  1  0
M  END

Associated Targets(Human)

CCR5 Tclin C-C chemokine receptor type 5 (5640 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.74Molecular Weight (Monoisotopic): 509.3617AlogP: 5.94#Rotatable Bonds: 6
Polar Surface Area: 53.09Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.97CX LogP: 5.45CX LogD: 3.88
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.48Np Likeness Score: -0.42

References

1. Rotstein DM, Gabriel SD, Makra F, Filonova L, Gleason S, Brotherton-Pleiss C, Setti LQ, Trejo-Martin A, Lee EK, Sankuratri S, Ji C, Derosier A, Dioszegi M, Heilek G, Jekle A, Berry P, Weller P, Mau CI..  (2009)  Spiropiperidine CCR5 antagonists.,  19  (18): [PMID:19674898] [10.1016/j.bmcl.2009.07.122]

Source