The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(3-ethoxy-5-(tetrahydro-2H-pyran-4-yloxy)benzyl)piperidin-4-yl)benzo[d]oxazol-2-amine ID: ALA1078745
PubChem CID: 11848625
Max Phase: Preclinical
Molecular Formula: C26H33N3O4
Molecular Weight: 451.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cc(CN2CCC(Nc3nc4ccccc4o3)CC2)cc(OC2CCOCC2)c1
Standard InChI: InChI=1S/C26H33N3O4/c1-2-31-22-15-19(16-23(17-22)32-21-9-13-30-14-10-21)18-29-11-7-20(8-12-29)27-26-28-24-5-3-4-6-25(24)33-26/h3-6,15-17,20-21H,2,7-14,18H2,1H3,(H,27,28)
Standard InChI Key: FDVIZOQPGHRQNB-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-4.1633 -24.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1645 -25.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4516 -25.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4535 -23.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7400 -24.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7396 -25.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9528 -25.4818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4645 -24.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9541 -24.1445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6395 -24.8141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2263 -25.5262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6379 -26.2429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2285 -26.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5969 -26.9566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0110 -26.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5998 -25.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0072 -27.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8322 -27.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2396 -28.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0637 -28.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4794 -27.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0643 -26.9603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2416 -26.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4762 -26.2429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3012 -26.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4737 -29.1074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2987 -29.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7085 -29.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7094 -26.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5304 -26.9611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9467 -26.2456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5350 -25.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7071 -25.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14 15 1 0
15 16 1 0
6 7 1 0
14 17 1 0
7 8 2 0
17 18 1 0
8 9 1 0
18 19 2 0
9 5 1 0
19 20 1 0
4 1 1 0
20 21 2 0
8 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
23 18 1 0
10 11 1 0
22 24 1 0
11 12 1 0
24 25 1 0
20 26 1 0
2 3 1 0
26 27 1 0
3 6 2 0
27 28 1 0
25 29 1 0
1 2 2 0
5 4 2 0
11 16 1 0
12 13 1 0
13 14 1 0
25 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.57Molecular Weight (Monoisotopic): 451.2471AlogP: 4.86#Rotatable Bonds: 8Polar Surface Area: 68.99Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.70CX Basic pKa: 7.53CX LogP: 3.23CX LogD: 2.86Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -0.99
References 1. Martin RE, Mohr P, Maerki HP, Guba W, Kuratli C, Gavelle O, Binggeli A, Bendels S, Alvarez-Sánchez R, Alker A, Polonchuk L, Christ AD.. (2009) Benzoxazole piperidines as selective and potent somatostatin receptor subtype 5 antagonists., 19 (21): [PMID:19786348 ] [10.1016/j.bmcl.2009.09.024 ]