The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-butyl-3-(cyclohexylmethyl)-9-(1-(2,6-dimethylbenzoyl)piperidin-4-yl)-1-oxa-3,9-diazaspiro[5.5]undecan-2-one ID: ALA1078753
PubChem CID: 11433740
Max Phase: Preclinical
Molecular Formula: C33H51N3O3
Molecular Weight: 537.79
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC1CN(CC2CCCCC2)C(=O)OC12CCN(C1CCN(C(=O)c3c(C)cccc3C)CC1)CC2
Standard InChI: InChI=1S/C33H51N3O3/c1-4-5-14-28-24-36(23-27-12-7-6-8-13-27)32(38)39-33(28)17-21-34(22-18-33)29-15-19-35(20-16-29)31(37)30-25(2)10-9-11-26(30)3/h9-11,27-29H,4-8,12-24H2,1-3H3
Standard InChI Key: TUOGNBAQCBUIHK-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
0.5542 -21.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9625 -21.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7792 -21.8984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1937 -21.1902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7854 -20.4777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9625 -20.4734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6986 -21.8608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1261 -21.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1605 -20.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6642 -20.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0962 -21.1405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9187 -21.1192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3136 -20.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1348 -20.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5672 -21.0761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1723 -21.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3450 -21.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3919 -21.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8232 -21.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7853 -20.3290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6487 -21.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0868 -22.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6864 -23.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8574 -23.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4299 -22.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6051 -22.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0428 -21.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5477 -22.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9579 -23.3248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5432 -24.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9534 -24.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2009 -19.7650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0187 -21.1940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4345 -20.4814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2579 -20.4884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6736 -19.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2679 -19.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4419 -19.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0217 -19.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
18 19 1 0
7 11 1 0
18 20 2 0
8 1 1 0
19 21 2 0
1 9 1 0
21 22 1 0
9 10 1 0
22 23 2 0
10 11 1 0
23 24 1 0
12 13 1 0
24 25 2 0
25 19 1 0
4 5 1 0
25 26 1 0
5 6 1 0
21 27 1 0
7 8 1 0
2 28 1 0
28 29 1 0
1 2 1 0
29 30 1 0
1 6 1 0
30 31 1 0
12 17 1 0
5 32 2 0
13 14 1 0
4 33 1 0
14 15 1 0
33 34 1 0
34 35 1 0
15 16 1 0
16 17 1 0
11 12 1 0
2 3 1 0
15 18 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.79Molecular Weight (Monoisotopic): 537.3930AlogP: 6.58#Rotatable Bonds: 7Polar Surface Area: 53.09Molecular Species: BASEHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.99CX LogP: 5.94CX LogD: 4.34Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.39Np Likeness Score: -0.31
References 1. Rotstein DM, Gabriel SD, Makra F, Filonova L, Gleason S, Brotherton-Pleiss C, Setti LQ, Trejo-Martin A, Lee EK, Sankuratri S, Ji C, Derosier A, Dioszegi M, Heilek G, Jekle A, Berry P, Weller P, Mau CI.. (2009) Spiropiperidine CCR5 antagonists., 19 (18): [PMID:19674898 ] [10.1016/j.bmcl.2009.07.122 ]