N-(3-benzyl-2,3,4,5-tetrahydro-1H-benzo[d]azepin-7-yl)-4-butylbenzenesulfonamide

ID: ALA1078807

PubChem CID: 46882348

Max Phase: Preclinical

Molecular Formula: C27H32N2O2S

Molecular Weight: 448.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCN(Cc2ccccc2)CC3)cc1

Standard InChI:  InChI=1S/C27H32N2O2S/c1-2-3-7-22-10-14-27(15-11-22)32(30,31)28-26-13-12-24-16-18-29(19-17-25(24)20-26)21-23-8-5-4-6-9-23/h4-6,8-15,20,28H,2-3,7,16-19,21H2,1H3

Standard InChI Key:  FWROZMQRBMGKLZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   12.7625  -10.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7613  -11.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4704  -12.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4685  -10.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0974  -11.2855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6759  -10.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8416  -10.3567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7375  -12.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8977  -12.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1882  -11.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1827  -10.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0500  -12.1319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3401  -11.7207    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.7429  -11.0090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9224  -11.0090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6261  -12.1258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9186  -11.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2053  -12.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1989  -12.9336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9116  -13.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6222  -12.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4857  -13.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7776  -12.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0646  -13.3310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3564  -12.9164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9903  -11.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4623  -12.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0370  -12.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5082  -13.5566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4022  -13.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8226  -12.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3489  -11.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
 13 16  1  0
 16 17  2  0
  5  6  1  0
 17 18  1  0
  6  7  1  0
 18 19  2  0
  5  8  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
 21 16  1  0
 10 11  1  0
 19 22  1  0
 11  7  1  0
 22 23  1  0
  8  9  1  0
 23 24  1  0
  2  3  1  0
 24 25  1  0
  2 12  1  0
  5 26  1  0
  3 10  2  0
 26 27  1  0
 12 13  1  0
 27 28  2  0
  1  2  2  0
 28 29  1  0
 13 14  2  0
 29 30  2  0
 11  4  2  0
 30 31  1  0
 13 15  2  0
 31 32  2  0
 32 27  1  0
M  END

Associated Targets(Human)

MLNR Tchem Motilin receptor (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.63Molecular Weight (Monoisotopic): 448.2184AlogP: 5.43#Rotatable Bonds: 8
Polar Surface Area: 49.41Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.27CX Basic pKa: 9.47CX LogP: 5.22CX LogD: 4.33
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.23

References

1. Bailey JM, Scott JS, Basilla JB, Bolton VJ, Boyfield I, Evans DG, Fleury E, Heightman TD, Jarvie EM, Lawless K, Matthews KL, McKay F, Mok H, Muir A, Orlek BS, Sanger GJ, Stemp G, Stevens AJ, Thompson M, Ward J, Vaidya K, Westaway SM..  (2009)  The discovery and optimisation of benzazepine sulfonamide and sulfones as potent agonists of the motilin receptor.,  19  (22): [PMID:19804969] [10.1016/j.bmcl.2009.09.027]

Source