4-(9-((3-mesityl-4,5-dihydroisoxazol-5-yl)methyl)-9H-purin-6-yl)morpholine

ID: ALA1078824

PubChem CID: 45102741

Max Phase: Preclinical

Molecular Formula: C22H26N6O2

Molecular Weight: 406.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(C2=NOC(Cn3cnc4c(N5CCOCC5)ncnc43)C2)c(C)c1

Standard InChI:  InChI=1S/C22H26N6O2/c1-14-8-15(2)19(16(3)9-14)18-10-17(30-26-18)11-28-13-25-20-21(23-12-24-22(20)28)27-4-6-29-7-5-27/h8-9,12-13,17H,4-7,10-11H2,1-3H3

Standard InChI Key:  WGVBOYZCHSPNRA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    4.1490   -0.2041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1478   -1.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8626   -1.4445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8608    0.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5763   -0.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5766   -1.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3671   -1.2882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8555   -0.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3667    0.0565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6223   -2.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4465   -2.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9361   -2.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7195   -2.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7176   -1.6533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9331   -1.4004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3872   -2.9585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3832   -3.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0953   -4.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8124   -3.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8128   -2.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1000   -2.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1008   -1.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5258   -4.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6667   -4.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8584    1.0337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5736    1.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5731    2.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8591    2.6834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1441    2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1429    1.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  5  4  2  0
  6  7  1  0
 16 17  2  0
  7  8  1  0
 17 18  1  0
  8  9  2  0
 18 19  2  0
  9  5  1  0
 19 20  1  0
  4  1  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
  7 10  1  0
 21 22  1  0
  5  6  1  0
 19 23  1  0
 10 11  1  0
 17 24  1  0
 11 12  1  0
  4 25  1  0
 25 26  1  0
  2  3  1  0
  3  6  2  0
  1  2  2  0
 12 13  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Associated Targets(non-human)

F2 Thrombin (1630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.49Molecular Weight (Monoisotopic): 406.2117AlogP: 2.78#Rotatable Bonds: 4
Polar Surface Area: 77.66Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.56CX LogP: 3.70CX LogD: 3.70
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -1.15

References

1. Thalassitis A, Hadjipavlou-Litina DJ, Litinas KE, Miltiadou P..  (2009)  Synthesis of modified homo-N-nucleosides from the reactions of mesityl nitrile oxide with 9-allylpurines and their influence on lipid peroxidation and thrombin inhibition.,  19  (22): [PMID:19811914] [10.1016/j.bmcl.2009.09.040]

Source