The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-(6-O-trans-sinapoylglucopyranosyl)gardendiol ID: ALA1078907
PubChem CID: 44255333
Max Phase: Preclinical
Molecular Formula: C27H34O13
Molecular Weight: 566.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)OC[C@H]2O[C@@H](OC[C@H]3C(=O)OC[C@@H]4C(CO)=CC[C@@H]43)[C@H](O)[C@@H](O)[C@@H]2O)cc(OC)c1O
Standard InChI: InChI=1S/C27H34O13/c1-35-18-7-13(8-19(36-2)22(18)30)3-6-21(29)37-12-20-23(31)24(32)25(33)27(40-20)39-11-17-15-5-4-14(9-28)16(15)10-38-26(17)34/h3-4,6-8,15-17,20,23-25,27-28,30-33H,5,9-12H2,1-2H3/b6-3+/t15-,16+,17+,20+,23+,24-,25+,27+/m0/s1
Standard InChI Key: MRSXXJYRGDMBIT-BFKATWTQSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
4.2268 -22.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9323 -23.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6539 -22.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3595 -23.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0851 -22.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7906 -23.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5121 -22.7845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5298 -21.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7705 -24.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4760 -24.4360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0489 -24.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0287 -25.2326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7343 -25.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3433 -23.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2429 -21.8709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5042 -23.0958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0374 -27.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9918 -26.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5083 -27.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1987 -26.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2271 -27.5393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4887 -27.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5453 -26.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3204 -28.5401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1286 -28.6828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2080 -25.8679 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.2362 -28.3569 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.2467 -26.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2214 -27.5504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9734 -26.3356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5707 -25.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2973 -25.0769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3226 -24.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0491 -23.8675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0763 -23.0465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3767 -22.6085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6483 -22.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6192 -23.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8043 -22.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4051 -21.7841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0517 -22.5609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1068 -24.2163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 6 2 0
6 7 1 0
7 8 1 0
20 23 1 0
21 22 1 0
22 29 1 0
6 9 1 0
17 24 1 0
9 10 1 0
24 25 1 0
9 11 2 0
20 26 1 1
11 12 1 0
21 27 1 1
12 13 1 0
23 28 1 0
11 14 1 0
28 29 1 0
4 14 2 0
28 30 2 0
1 15 2 0
23 31 1 1
31 32 1 0
1 16 1 0
33 32 1 1
33 34 1 0
17 21 1 0
1 2 1 0
2 3 2 0
3 4 1 0
20 18 1 0
33 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
18 19 1 0
35 39 1 1
39 16 1 0
19 17 2 0
36 40 1 6
20 21 1 0
37 41 1 1
4 5 1 0
38 42 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 566.56Molecular Weight (Monoisotopic): 566.1999AlogP: -0.48#Rotatable Bonds: 10Polar Surface Area: 190.67Molecular Species: NEUTRALHBA: 13HBD: 5#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.29CX Basic pKa: ┄CX LogP: -0.27CX LogD: -0.27Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.14Np Likeness Score: 2.14
References 1. Yu Y, Xie ZL, Gao H, Ma WW, Dai Y, Wang Y, Zhong Y, Yao XS.. (2009) Bioactive iridoid glucosides from the fruit of Gardenia jasminoides., 72 (8): [PMID:19650637 ] [10.1021/np900176q ]