N-(9-((3-mesityl-4,5-dihydroisoxazol-5-yl)methyl)-9H-purin-6-yl)benzamide

ID: ALA1078924

PubChem CID: 45102744

Max Phase: Preclinical

Molecular Formula: C25H24N6O2

Molecular Weight: 440.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(C2=NOC(Cn3cnc4c(NC(=O)c5ccccc5)ncnc43)C2)c(C)c1

Standard InChI:  InChI=1S/C25H24N6O2/c1-15-9-16(2)21(17(3)10-15)20-11-19(33-30-20)12-31-14-28-22-23(26-13-27-24(22)31)29-25(32)18-7-5-4-6-8-18/h4-10,13-14,19H,11-12H2,1-3H3,(H,26,27,29,32)

Standard InChI Key:  HHBYHCQDHLOOMW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    3.8377   -9.3414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8365  -10.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5516  -10.5821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5498   -8.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2655   -9.3377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2658  -10.1691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0565  -10.4259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5451   -9.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0561   -9.0806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3118  -11.2107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1363  -11.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6261  -11.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4097  -11.6154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4078  -10.7909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6231  -10.5380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0776  -12.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0736  -12.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7860  -13.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5033  -12.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5037  -12.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7907  -11.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7915  -10.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2170  -13.3423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3569  -13.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5474   -8.1031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2609   -7.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2584   -6.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9769   -8.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9738   -6.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9717   -5.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2552   -5.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5393   -5.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5449   -6.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  4  2  0
  6  7  1  0
 16 17  2  0
  7  8  1  0
 17 18  1  0
  8  9  2  0
 18 19  2  0
  9  5  1  0
 19 20  1  0
  4  1  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
  7 10  1  0
 21 22  1  0
  5  6  1  0
 19 23  1  0
 10 11  1  0
 17 24  1  0
 11 12  1  0
  4 25  1  0
 25 26  1  0
  2  3  1  0
 26 27  1  0
  3  6  2  0
 26 28  2  0
  1  2  2  0
 27 29  2  0
 12 13  1  0
 29 30  1  0
 13 14  2  0
 30 31  2  0
 14 15  1  0
 31 32  1  0
 15 11  1  0
 32 33  2  0
 33 27  1  0
M  END

Associated Targets(non-human)

F2 Thrombin (1630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.51Molecular Weight (Monoisotopic): 440.1961AlogP: 4.20#Rotatable Bonds: 5
Polar Surface Area: 94.29Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.34CX Basic pKa: 3.02CX LogP: 4.90CX LogD: 4.90
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.93

References

1. Thalassitis A, Hadjipavlou-Litina DJ, Litinas KE, Miltiadou P..  (2009)  Synthesis of modified homo-N-nucleosides from the reactions of mesityl nitrile oxide with 9-allylpurines and their influence on lipid peroxidation and thrombin inhibition.,  19  (22): [PMID:19811914] [10.1016/j.bmcl.2009.09.040]

Source