The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-butyl-9-(1-(2,4-dimethylnicotinoyl)-4-methylpiperidin-4-yl)-3-((tetrahydro-2H-pyran-4-yl)methyl)-1-oxa-3,9-diazaspiro[5.5]undecan-2-one ID: ALA1078936
PubChem CID: 46883025
Max Phase: Preclinical
Molecular Formula: C32H50N4O4
Molecular Weight: 554.78
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC[C@H]1CN(CC2CCOCC2)C(=O)OC12CCN(C1(C)CCN(C(=O)c3c(C)ccnc3C)CC1)CC2
Standard InChI: InChI=1S/C32H50N4O4/c1-5-6-7-27-23-35(22-26-9-20-39-21-10-26)30(38)40-32(27)13-18-36(19-14-32)31(4)11-16-34(17-12-31)29(37)28-24(2)8-15-33-25(28)3/h8,15,26-27H,5-7,9-14,16-23H2,1-4H3/t27-/m0/s1
Standard InChI Key: POKLFLYOUOPFHQ-MHZLTWQESA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
0.5375 -6.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9458 -6.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7625 -6.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1770 -6.2319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7687 -5.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9458 -5.5151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7153 -6.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1095 -6.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1439 -5.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6809 -5.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1128 -6.1821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9354 -6.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3303 -5.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1514 -5.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5839 -6.1177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1890 -6.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3617 -6.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4086 -6.0959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8399 -6.7991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8020 -5.3707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6653 -6.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1035 -7.4765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7031 -8.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8741 -8.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4466 -7.5188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6218 -7.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0595 -6.0480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5311 -7.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9413 -8.3664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5265 -9.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9367 -9.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1842 -4.8067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0020 -6.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4178 -5.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2412 -5.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6569 -4.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2512 -4.1028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4253 -4.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0050 -4.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3542 -5.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 19 1 0
7 11 1 0
18 20 2 0
8 1 1 0
19 21 2 0
1 9 1 0
21 22 1 0
9 10 1 0
22 23 2 0
10 11 1 0
23 24 1 0
12 13 1 0
24 25 2 0
25 19 1 0
4 5 1 0
25 26 1 0
5 6 1 0
21 27 1 0
7 8 1 0
2 28 1 6
28 29 1 0
1 2 1 0
29 30 1 0
1 6 1 0
30 31 1 0
12 17 1 0
5 32 2 0
13 14 1 0
4 33 1 0
14 15 1 0
33 34 1 0
34 35 1 0
15 16 1 0
16 17 1 0
11 12 1 0
2 3 1 0
15 18 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
3 4 1 0
12 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.78Molecular Weight (Monoisotopic): 554.3832AlogP: 5.21#Rotatable Bonds: 7Polar Surface Area: 75.21Molecular Species: BASEHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.20CX LogP: 2.93CX LogD: 1.12Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.46Np Likeness Score: -0.14
References 1. Rotstein DM, Gabriel SD, Makra F, Filonova L, Gleason S, Brotherton-Pleiss C, Setti LQ, Trejo-Martin A, Lee EK, Sankuratri S, Ji C, Derosier A, Dioszegi M, Heilek G, Jekle A, Berry P, Weller P, Mau CI.. (2009) Spiropiperidine CCR5 antagonists., 19 (18): [PMID:19674898 ] [10.1016/j.bmcl.2009.07.122 ]