The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-(4-(5-butyl-3-methyl-2-oxo-1-oxa-3,9-diazaspiro[5.5]undecan-9-yl)-4-methylpiperidine-1-carbonyl)-4,6-dimethylpicolinonitrile ID: ALA1078937
PubChem CID: 46883028
Max Phase: Preclinical
Molecular Formula: C28H41N5O3
Molecular Weight: 495.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC[C@H]1CN(C)C(=O)OC12CCN(C1(C)CCN(C(=O)c3c(C)cc(C#N)nc3C)CC1)CC2
Standard InChI: InChI=1S/C28H41N5O3/c1-6-7-8-22-19-31(5)26(35)36-28(22)11-15-33(16-12-28)27(4)9-13-32(14-10-27)25(34)24-20(2)17-23(18-29)30-21(24)3/h17,22H,6-16,19H2,1-5H3/t22-/m0/s1
Standard InChI Key: LLQOAGQUGSEMLC-QFIPXVFZSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
16.2667 -11.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6750 -11.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4917 -11.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9062 -11.1611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4979 -10.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6750 -10.4443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0139 -11.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8386 -11.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8730 -10.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0483 -10.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6163 -11.1113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7938 -11.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3989 -10.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5777 -10.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1453 -11.0469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5402 -11.7724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3675 -11.7948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3206 -11.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8893 -11.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9272 -10.2999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0638 -11.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6326 -12.4056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0261 -13.1318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8551 -13.1511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2826 -12.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1074 -12.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6720 -10.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2602 -12.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6704 -13.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2557 -14.0088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6659 -14.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9134 -9.7358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7312 -11.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3750 -10.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5957 -13.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1743 -14.5409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11 12 1 0
2 3 1 0
15 18 1 0
3 4 1 0
18 19 1 0
7 11 1 0
18 20 2 0
8 1 1 0
19 21 2 0
1 9 1 0
21 22 1 0
9 10 1 0
22 23 2 0
10 11 1 0
23 24 1 0
12 13 1 0
24 25 2 0
25 19 1 0
4 5 1 0
25 26 1 0
5 6 1 0
21 27 1 0
7 8 1 0
2 28 1 6
28 29 1 0
1 2 1 0
29 30 1 0
1 6 1 0
30 31 1 0
12 17 1 0
5 32 2 0
13 14 1 0
4 33 1 0
14 15 1 0
12 34 1 0
15 16 1 0
23 35 1 0
16 17 1 0
35 36 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.67Molecular Weight (Monoisotopic): 495.3209AlogP: 4.29#Rotatable Bonds: 5Polar Surface Area: 89.77Molecular Species: BASEHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.20CX LogP: 2.75CX LogD: 0.95Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.61Np Likeness Score: -0.16
References 1. Rotstein DM, Gabriel SD, Makra F, Filonova L, Gleason S, Brotherton-Pleiss C, Setti LQ, Trejo-Martin A, Lee EK, Sankuratri S, Ji C, Derosier A, Dioszegi M, Heilek G, Jekle A, Berry P, Weller P, Mau CI.. (2009) Spiropiperidine CCR5 antagonists., 19 (18): [PMID:19674898 ] [10.1016/j.bmcl.2009.07.122 ]