The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(2-amino-2-methylpropyl)phenyl)-4-(3-hexylureido)benzenesulfonamide ID: ALA1079045
PubChem CID: 46882804
Max Phase: Preclinical
Molecular Formula: C23H34N4O3S
Molecular Weight: 446.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCNC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(CC(C)(C)N)cc2)cc1
Standard InChI: InChI=1S/C23H34N4O3S/c1-4-5-6-7-16-25-22(28)26-19-12-14-21(15-13-19)31(29,30)27-20-10-8-18(9-11-20)17-23(2,3)24/h8-15,27H,4-7,16-17,24H2,1-3H3,(H2,25,26,28)
Standard InChI Key: RHQJLSVFJVOPOM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
18.4870 -12.4317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9038 -13.1485 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.3162 -12.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3438 -14.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0564 -14.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7691 -14.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4817 -14.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1944 -14.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9070 -14.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6221 -14.8063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3362 -14.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0513 -14.8046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3352 -13.5677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7654 -14.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4796 -14.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1933 -14.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1928 -13.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4726 -13.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7620 -13.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6220 -13.5626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3364 -13.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0503 -13.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7641 -13.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7642 -12.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0444 -11.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3334 -12.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4780 -11.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1934 -12.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9072 -11.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1949 -13.1477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9048 -12.7318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
16 17 2 0
3 2 2 0
17 18 1 0
9 10 1 0
18 19 2 0
19 14 1 0
17 2 1 0
5 6 1 0
2 20 1 0
10 11 1 0
20 21 1 0
21 22 2 0
11 12 1 0
22 23 1 0
6 7 1 0
23 24 2 0
11 13 2 0
24 25 1 0
2 1 2 0
25 26 2 0
26 21 1 0
12 14 1 0
24 27 1 0
7 8 1 0
27 28 1 0
14 15 2 0
28 29 1 0
4 5 1 0
28 30 1 0
15 16 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.62Molecular Weight (Monoisotopic): 446.2352AlogP: 4.47#Rotatable Bonds: 11Polar Surface Area: 113.32Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.04CX Basic pKa: 10.25CX LogP: 3.01CX LogD: 2.34Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -1.14
References 1. Pasternak A, Goble SD, deJesus RK, Hreniuk DL, Chung CC, Tota MR, Mazur P, Feighner SD, Howard AD, Mills SG, Yang L.. (2009) Discovery and optimization of novel 4-[(aminocarbonyl)amino]-N-[4-(2-aminoethyl)phenyl]benzenesulfonamide ghrelin receptor antagonists., 19 (21): [PMID:19767208 ] [10.1016/j.bmcl.2009.08.076 ]