6'-O-acetylgeniposide

ID: ALA1079151

PubChem CID: 44253991

Max Phase: Preclinical

Molecular Formula: C19H26O11

Molecular Weight: 430.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 6'-O-Acetylgeniposide | 6'-O-acetylgeniposide|CHEMBL1079151

Canonical SMILES:  COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C(CO)=CC[C@H]12

Standard InChI:  InChI=1S/C19H26O11/c1-8(21)27-7-12-14(22)15(23)16(24)19(29-12)30-18-13-9(5-20)3-4-10(13)11(6-28-18)17(25)26-2/h3,6,10,12-16,18-20,22-24H,4-5,7H2,1-2H3/t10-,12-,13-,14-,15+,16-,18+,19+/m1/s1

Standard InChI Key:  RANJFIZSJJZWRL-BZDYRZRUSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   14.5483   -0.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5938    0.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0788    0.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3848    0.5394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3565   -0.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8447    0.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1266    0.9378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2661   -1.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4602   -1.4465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1528    1.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8733    2.1438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4586    2.1891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0415   -1.5709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7347   -2.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7034   -2.8233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3970   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1209   -2.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1514   -2.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4532   -1.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3654   -4.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8741   -1.6739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4838   -0.8002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8122   -3.3097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3755    1.3605    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.3473   -1.1215    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.5675    1.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0615   -4.5100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0297   -5.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3036   -5.7165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7274   -5.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8165   -0.3552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0701   -0.7533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7846   -1.1658    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  4  7  1  0
 14 13  1  1
 14 15  1  0
  5 32  1  0
 32 31  1  0
 31  6  1  0
  6  7  2  0
  1  5  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  1  8  1  0
 16 20  1  1
 18 21  1  1
  8  9  1  0
 19 22  1  6
  4  2  1  0
 17 23  1  6
  7 10  1  0
  4 24  1  1
  2  3  1  0
  5 25  1  1
 10 11  1  0
 11 26  1  0
  3  1  2  0
 20 27  1  0
 10 12  2  0
 27 28  1  0
  4  5  1  0
 32 13  1  0
 28 29  2  0
 28 30  1  0
 32 33  1  6
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Drosophila (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.41Molecular Weight (Monoisotopic): 430.1475AlogP: -1.66#Rotatable Bonds: 6
Polar Surface Area: 161.21Molecular Species: NEUTRALHBA: 11HBD: 4
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.21CX Basic pKa: CX LogP: -1.77CX LogD: -1.77
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.28Np Likeness Score: 2.69

References

1. Yu Y, Xie ZL, Gao H, Ma WW, Dai Y, Wang Y, Zhong Y, Yao XS..  (2009)  Bioactive iridoid glucosides from the fruit of Gardenia jasminoides.,  72  (8): [PMID:19650637] [10.1021/np900176q]

Source