N-(5-((7-(4-butylphenylsulfonamido)-4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)methyl)thiophen-2-yl)acetamide

ID: ALA1079170

PubChem CID: 46882393

Max Phase: Preclinical

Molecular Formula: C27H33N3O3S2

Molecular Weight: 511.71

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCN(Cc2ccc(NC(C)=O)s2)CC3)cc1

Standard InChI:  InChI=1S/C27H33N3O3S2/c1-3-4-5-21-6-11-26(12-7-21)35(32,33)29-24-9-8-22-14-16-30(17-15-23(22)18-24)19-25-10-13-27(34-25)28-20(2)31/h6-13,18,29H,3-5,14-17,19H2,1-2H3,(H,28,31)

Standard InChI Key:  UOAUSRFWBALLMN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    1.9585  -18.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9573  -19.6862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6664  -20.0969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6645  -18.4526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2934  -19.2490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8718  -18.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0376  -18.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9335  -20.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0937  -20.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3843  -19.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3787  -18.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2461  -20.0955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5360  -19.6842    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.9391  -18.9726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1185  -18.9726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1778  -20.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8852  -19.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5986  -20.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6051  -20.8971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8922  -21.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1817  -20.9056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3181  -21.3030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0262  -20.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7393  -21.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4474  -20.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1863  -19.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6585  -19.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4101  -20.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1474  -21.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8550  -20.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5553  -19.9504    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.6383  -21.2219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4022  -20.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1855  -21.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3827  -19.8652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  2  0
  5  6  1  0
 17 18  1  0
  6  7  1  0
 18 19  2  0
  5  8  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
 21 16  1  0
 10 11  1  0
 19 22  1  0
 11  7  1  0
 22 23  1  0
  8  9  1  0
 23 24  1  0
  2  3  1  0
 24 25  1  0
  2 12  1  0
  5 26  1  0
  3 10  2  0
 26 27  1  0
 27 28  2  0
 12 13  1  0
  1  2  2  0
 13 14  2  0
 11  4  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  1  0
 13 15  2  0
 30 32  1  0
  4  1  1  0
 32 33  1  0
 13 16  1  0
 33 34  1  0
 33 35  2  0
M  END

Associated Targets(Human)

GHSR Tclin Ghrelin receptor (6229 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MLNR Tchem Motilin receptor (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.71Molecular Weight (Monoisotopic): 511.1963AlogP: 5.45#Rotatable Bonds: 9
Polar Surface Area: 78.51Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.95CX Basic pKa: 8.80CX LogP: 4.72CX LogD: 4.35
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -1.52

References

1. Bailey JM, Scott JS, Basilla JB, Bolton VJ, Boyfield I, Evans DG, Fleury E, Heightman TD, Jarvie EM, Lawless K, Matthews KL, McKay F, Mok H, Muir A, Orlek BS, Sanger GJ, Stemp G, Stevens AJ, Thompson M, Ward J, Vaidya K, Westaway SM..  (2009)  The discovery and optimisation of benzazepine sulfonamide and sulfones as potent agonists of the motilin receptor.,  19  (22): [PMID:19804969] [10.1016/j.bmcl.2009.09.027]

Source