The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-methoxybenzyl)-8-((2-(methylamino)ethylamino)methyl)-2-(trifluoromethyl)pyrazolo[1,5-a]quinoxalin-4(5H)-one ID: ALA1079704
PubChem CID: 46879425
Max Phase: Preclinical
Molecular Formula: C23H24F3N5O2
Molecular Weight: 459.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNCCNCc1ccc2c(c1)n1nc(C(F)(F)F)cc1c(=O)n2Cc1ccccc1OC
Standard InChI: InChI=1S/C23H24F3N5O2/c1-27-9-10-28-13-15-7-8-17-18(11-15)31-19(12-21(29-31)23(24,25)26)22(32)30(17)14-16-5-3-4-6-20(16)33-2/h3-8,11-12,27-28H,9-10,13-14H2,1-2H3
Standard InChI Key: IQABLZHKDBHKNU-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
11.2123 -20.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2123 -21.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9260 -22.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6442 -21.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4985 -22.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7848 -21.8201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0712 -22.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3575 -21.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6439 -22.2322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9302 -21.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9260 -20.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6424 -20.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3601 -20.5862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3676 -19.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9272 -19.7468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6486 -19.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4802 -18.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6544 -18.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3127 -19.1878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2460 -17.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6617 -17.0033 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.4219 -17.7107 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.8277 -16.9992 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0844 -19.3499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0706 -21.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7874 -20.5971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4946 -21.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2110 -20.6095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2177 -19.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5022 -19.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7887 -19.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4870 -21.8395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7695 -22.2448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 7 1 0
2 3 2 0
7 8 1 0
3 4 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 15 1 0
8 9 1 0
18 20 1 0
4 12 2 0
20 21 1 0
9 10 1 0
20 22 1 0
11 12 1 0
20 23 1 0
14 24 2 0
2 5 1 0
13 25 1 0
1 2 1 0
25 26 1 0
5 6 1 0
26 27 2 0
11 15 1 0
27 28 1 0
12 13 1 0
28 29 2 0
13 14 1 0
29 30 1 0
14 16 1 0
30 31 2 0
31 26 1 0
15 16 1 0
27 32 1 0
1 11 2 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.47Molecular Weight (Monoisotopic): 459.1882AlogP: 3.03#Rotatable Bonds: 8Polar Surface Area: 72.59Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.60CX LogP: 2.99CX LogD: 0.79Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -1.08
References 1. Therrien E, Larouche G, Manku S, Allan M, Nguyen N, Styhler S, Robert MF, Goulet AC, Besterman JM, Nguyen H, Wahhab A.. (2009) 1,2-Diamines as inhibitors of co-activator associated arginine methyltransferase 1 (CARM1)., 19 (23): [PMID:19836951 ] [10.1016/j.bmcl.2009.09.110 ]