The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1E,2E)-1-(Piperidin-1-yl)-1-[(4-nitrophenyl)hydrazono]-2-[(3-methylbenzofuran-2-oyl)hydrazono]propane ID: ALA1079863
PubChem CID: 46882255
Max Phase: Preclinical
Molecular Formula: C24H26N6O4
Molecular Weight: 462.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=N\NC(=O)c1oc2ccccc2c1C)/C(=N/Nc1ccc([N+](=O)[O-])cc1)N1CCCCC1
Standard InChI: InChI=1S/C24H26N6O4/c1-16-20-8-4-5-9-21(20)34-22(16)24(31)28-25-17(2)23(29-14-6-3-7-15-29)27-26-18-10-12-19(13-11-18)30(32)33/h4-5,8-13,26H,3,6-7,14-15H2,1-2H3,(H,28,31)/b25-17+,27-23-
Standard InChI Key: VFWGRJZIKURBTO-WPESQJOVSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-5.4858 -13.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1020 -14.1291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2773 -14.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0477 -12.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2242 -12.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8374 -13.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0184 -13.3240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8990 -12.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6442 -12.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7838 -11.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1688 -12.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4712 -12.5579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1363 -11.2933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7411 -12.1739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0435 -12.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6866 -12.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0760 -13.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3842 -12.6705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7190 -11.4059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1143 -12.2864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8120 -12.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -13.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4717 -13.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2029 -13.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2329 -12.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5353 -12.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4498 -11.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4841 -10.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7884 -9.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0566 -10.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0204 -10.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9033 -14.0474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6330 -13.6624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8719 -14.8717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6 7 1 0
15 17 1 0
7 8 1 0
16 18 2 0
8 9 2 0
16 19 1 0
9 5 1 0
18 20 1 0
4 1 1 0
20 21 1 0
9 10 1 0
21 22 2 0
5 6 1 0
22 23 1 0
8 11 1 0
23 24 2 0
24 25 1 0
11 12 1 0
25 26 2 0
26 21 1 0
19 27 1 0
2 3 1 0
11 13 2 0
3 6 2 0
12 14 1 0
1 2 2 0
19 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
14 15 2 0
5 4 2 0
15 16 1 0
32 33 2 0
32 34 1 0
24 32 1 0
M CHG 2 32 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.51Molecular Weight (Monoisotopic): 462.2016AlogP: 4.67#Rotatable Bonds: 6Polar Surface Area: 125.37Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.50CX Basic pKa: 5.05CX LogP: 4.63CX LogD: 4.63Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: -1.19
References 1. Abdel-Aziz HA, Mekawey AA.. (2009) Stereoselective synthesis and antimicrobial activity of benzofuran-based (1E)-1-(piperidin-1-yl)-N2-arylamidrazones., 44 (12): [PMID:19782439 ] [10.1016/j.ejmech.2009.09.002 ]