The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-((2-(ethylamino)ethylamino)methyl)phenyl)-N-(2-methoxybenzyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide ID: ALA1080124
PubChem CID: 46880002
Max Phase: Preclinical
Molecular Formula: C24H28F3N5O2
Molecular Weight: 475.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCNCCNCc1cccc(-n2nc(C(F)(F)F)cc2C(=O)NCc2ccccc2OC)c1
Standard InChI: InChI=1S/C24H28F3N5O2/c1-3-28-11-12-29-15-17-7-6-9-19(13-17)32-20(14-22(31-32)24(25,26)27)23(33)30-16-18-8-4-5-10-21(18)34-2/h4-10,13-14,28-29H,3,11-12,15-16H2,1-2H3,(H,30,33)
Standard InChI Key: RTTYGSOJLHFJNM-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
12.6545 -13.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6545 -14.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3689 -15.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0880 -14.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0880 -13.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3689 -13.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3627 -12.5334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0289 -12.0474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7734 -11.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9484 -11.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6947 -12.0494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5189 -10.5599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9144 -9.8359 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.6941 -10.5794 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.1618 -9.8118 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.7432 -12.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7428 -13.2852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4571 -13.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1717 -13.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4578 -12.0481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8819 -13.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5961 -13.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5969 -12.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8776 -12.0516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1663 -12.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8791 -14.5266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5921 -14.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9400 -15.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2255 -14.6071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5111 -15.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7965 -14.6072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0822 -15.0198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3676 -14.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6532 -15.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 2 0
16 17 1 0
2 3 2 0
17 18 1 0
3 4 1 0
18 19 1 0
8 9 2 0
16 20 2 0
9 10 1 0
19 21 2 0
10 11 2 0
21 22 1 0
11 7 1 0
22 23 2 0
6 7 1 0
23 24 1 0
4 5 2 0
24 25 2 0
25 19 1 0
10 12 1 0
21 26 1 0
5 6 1 0
26 27 1 0
12 13 1 0
2 28 1 0
7 8 1 0
28 29 1 0
12 14 1 0
29 30 1 0
30 31 1 0
12 15 1 0
31 32 1 0
1 2 1 0
32 33 1 0
8 16 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.52Molecular Weight (Monoisotopic): 475.2195AlogP: 3.53#Rotatable Bonds: 11Polar Surface Area: 80.21Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.64CX Basic pKa: 9.68CX LogP: 3.43CX LogD: 1.16Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.47
References 1. Therrien E, Larouche G, Manku S, Allan M, Nguyen N, Styhler S, Robert MF, Goulet AC, Besterman JM, Nguyen H, Wahhab A.. (2009) 1,2-Diamines as inhibitors of co-activator associated arginine methyltransferase 1 (CARM1)., 19 (23): [PMID:19836951 ] [10.1016/j.bmcl.2009.09.110 ]