The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(16S*)-(9alpha-16alpha),(15-16alpha)-diepoxy-13beta,14beta-dihydroxy-15R-ethoxylabdan-6beta(19)-olide ID: ALA1080253
PubChem CID: 44254084
Max Phase: Preclinical
Molecular Formula: C22H34O7
Molecular Weight: 410.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Marrulibacetal | Marrulibacetal|CHEMBL1080253
Canonical SMILES: CCO[C@@H]1O[C@@H]2O[C@]3(CC[C@]2(O)[C@H]1O)[C@H](C)C[C@H]1OC(=O)[C@@]2(C)CCC[C@@]3(C)[C@@H]12
Standard InChI: InChI=1S/C22H34O7/c1-5-26-16-15(23)21(25)9-10-22(29-18(21)28-16)12(2)11-13-14-19(3,17(24)27-13)7-6-8-20(14,22)4/h12-16,18,23,25H,5-11H2,1-4H3/t12-,13-,14+,15+,16-,18-,19+,20+,21+,22-/m1/s1
Standard InChI Key: ROLCCWPTXCTWNC-PQWYHOPNSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
12.3299 -14.2840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1274 -14.0668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9547 -12.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7419 -13.7063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1982 -14.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1982 -15.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9120 -15.9369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9120 -14.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6215 -14.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6231 -15.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3313 -15.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0448 -15.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0474 -14.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1205 -16.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1001 -16.6982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6269 -17.3903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1897 -16.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6167 -16.3462 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.7620 -14.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0439 -16.3466 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.7522 -12.6888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3383 -13.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0717 -12.8913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9388 -12.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1233 -11.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1629 -12.0960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7444 -11.2171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5205 -11.4896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3201 -11.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9019 -11.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9207 -13.8497 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.2026 -13.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
11 12 1 0
12 13 1 0
13 1 1 0
7 14 1 0
14 15 1 0
11 15 1 0
14 16 2 0
7 17 1 6
10 18 1 6
13 19 1 6
2 22 1 0
11 20 1 6
21 22 1 0
21 3 1 0
3 4 1 0
1 2 1 0
1 4 1 1
22 23 1 0
23 24 1 0
24 25 1 0
25 21 1 0
5 6 1 0
21 26 1 1
5 8 1 0
25 27 1 1
6 7 1 0
24 28 1 6
7 10 1 0
28 29 1 0
9 8 1 0
29 30 1 0
9 10 1 0
22 31 1 1
9 1 1 0
9 32 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.51Molecular Weight (Monoisotopic): 410.2305AlogP: 2.12#Rotatable Bonds: 2Polar Surface Area: 94.45Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.77CX Basic pKa: ┄CX LogP: 2.61CX LogD: 2.61Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: 3.33
References 1. Rigano D, Aviello G, Bruno M, Formisano C, Rosselli S, Capasso R, Senatore F, Izzo AA, Borrelli F.. (2009) Antispasmodic effects and structure-activity relationships of labdane diterpenoids from Marrubium globosum ssp. libanoticum., 72 (8): [PMID:19650652 ] [10.1021/np9002756 ]