The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((2-methoxynaphthalen-1-yl)methyl)-1-(3-((2-(methylamino)ethylamino)methyl)phenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide ID: ALA1080335
PubChem CID: 46880199
Max Phase: Preclinical
Molecular Formula: C27H28F3N5O2
Molecular Weight: 511.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNCCNCc1cccc(-n2nc(C(F)(F)F)cc2C(=O)NCc2c(OC)ccc3ccccc23)c1
Standard InChI: InChI=1S/C27H28F3N5O2/c1-31-12-13-32-16-18-6-5-8-20(14-18)35-23(15-25(34-35)27(28,29)30)26(36)33-17-22-21-9-4-3-7-19(21)10-11-24(22)37-2/h3-11,14-15,31-32H,12-13,16-17H2,1-2H3,(H,33,36)
Standard InChI Key: FRELWJNLIPWVFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
11.5174 -7.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5174 -8.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2319 -9.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9508 -8.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9508 -7.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2319 -7.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2256 -6.6940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8918 -6.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6363 -5.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8113 -5.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5576 -6.2100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3819 -4.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7773 -3.9967 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.5571 -4.7400 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0247 -3.9726 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.6061 -6.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6039 -7.4470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0146 -8.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8401 -8.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3207 -6.2088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8029 -9.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0885 -8.7677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3741 -9.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6596 -8.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9452 -9.1804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2307 -8.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4879 -8.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0705 -7.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2470 -7.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0746 -8.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2504 -8.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8376 -9.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2478 -10.3019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0752 -10.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4843 -9.5889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8313 -6.7370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2406 -6.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
3 4 1 0
18 19 1 0
8 9 2 0
16 20 2 0
9 10 1 0
2 21 1 0
10 11 2 0
21 22 1 0
11 7 1 0
22 23 1 0
6 7 1 0
23 24 1 0
4 5 2 0
24 25 1 0
10 12 1 0
25 26 1 0
19 31 2 0
5 6 1 0
30 27 2 0
12 13 1 0
27 28 1 0
7 8 1 0
28 29 2 0
29 19 1 0
12 14 1 0
30 31 1 0
12 15 1 0
31 32 1 0
1 2 1 0
32 33 2 0
8 16 1 0
33 34 1 0
1 6 2 0
34 35 2 0
35 30 1 0
16 17 1 0
29 36 1 0
2 3 2 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.55Molecular Weight (Monoisotopic): 511.2195AlogP: 4.29#Rotatable Bonds: 10Polar Surface Area: 80.21Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.61CX LogP: 4.07CX LogD: 1.86Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -1.13
References 1. Therrien E, Larouche G, Manku S, Allan M, Nguyen N, Styhler S, Robert MF, Goulet AC, Besterman JM, Nguyen H, Wahhab A.. (2009) 1,2-Diamines as inhibitors of co-activator associated arginine methyltransferase 1 (CARM1)., 19 (23): [PMID:19836951 ] [10.1016/j.bmcl.2009.09.110 ]