The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7beta-O-benzylrosmanol ID: ALA1080422
PubChem CID: 44254787
Max Phase: Preclinical
Molecular Formula: C27H32O5
Molecular Weight: 436.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 7Beta-O-Benzylrosmanol | 7beta-O-benzylrosmanol|CHEMBL1080422
Canonical SMILES: CC(C)c1cc2c(c(O)c1O)[C@@]13CCCC(C)(C)[C@@H]1[C@H](OC3=O)[C@@H]2OCc1ccccc1
Standard InChI: InChI=1S/C27H32O5/c1-15(2)17-13-18-19(21(29)20(17)28)27-12-8-11-26(3,4)24(27)23(32-25(27)30)22(18)31-14-16-9-6-5-7-10-16/h5-7,9-10,13,15,22-24,28-29H,8,11-12,14H2,1-4H3/t22-,23-,24+,27+/m1/s1
Standard InChI Key: IJWMBORSRYALGH-INADMSBESA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
10.1841 -0.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1841 -1.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8937 -1.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8937 0.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6076 -0.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6087 -1.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3215 -1.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0338 -1.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3194 0.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0315 -0.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7486 0.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7507 1.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0294 1.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3196 1.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4732 -2.1261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1026 -2.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6043 -1.8242 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.6001 0.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0133 1.2331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3187 -0.5868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6028 1.4709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0279 2.2972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4672 1.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1791 1.0577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4676 2.2955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7504 -1.4137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3145 -2.2536 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.4788 -0.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2087 -1.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2046 -2.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9337 -2.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6631 -2.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6588 -1.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9292 -0.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 16 1 0
6 7 1 0
6 17 1 6
7 8 1 0
5 18 1 1
8 10 1 0
18 19 2 0
3 6 1 0
20 18 1 0
5 4 1 0
14 21 1 0
9 10 2 0
13 22 1 0
5 6 1 0
12 23 1 0
10 11 1 0
23 24 1 0
23 25 1 0
20 7 1 0
11 12 2 0
8 26 1 1
1 2 1 0
7 27 1 1
12 13 1 0
26 28 1 0
1 4 1 0
28 29 1 0
13 14 2 0
29 30 2 0
14 9 1 0
30 31 1 0
2 3 1 0
31 32 2 0
3 15 1 0
32 33 1 0
5 9 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.55Molecular Weight (Monoisotopic): 436.2250AlogP: 5.48#Rotatable Bonds: 4Polar Surface Area: 75.99Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.18CX Basic pKa: ┄CX LogP: 5.95CX LogD: 5.94Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: 2.05
References 1. Marrero JG, Moujir L, Andrés LS, Montaño NP, Araujo L, Luis JG.. (2009) Semisynthesis and biological evaluation of abietane-type diterpenes. Revision of the structure of rosmaquinone., 72 (8): [PMID:19711987 ] [10.1021/np900047p ]