1-(4-benzhydrylpiperazin-1-yl)-6,6-diphenylhexan-1-one

ID: ALA1080461

PubChem CID: 46879971

Max Phase: Preclinical

Molecular Formula: C35H38N2O

Molecular Weight: 502.70

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCCC(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1

Standard InChI:  InChI=1S/C35H38N2O/c38-34(24-14-13-23-33(29-15-5-1-6-16-29)30-17-7-2-8-18-30)36-25-27-37(28-26-36)35(31-19-9-3-10-20-31)32-21-11-4-12-22-32/h1-12,15-22,33,35H,13-14,23-28H2

Standard InChI Key:  DNMNLRHDLUAUHW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    8.8250  -25.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6500  -25.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0602  -25.1061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6500  -24.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8250  -24.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4102  -25.1061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5852  -25.1073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1717  -24.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1737  -25.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5861  -23.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1733  -22.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3474  -22.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9361  -23.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3512  -24.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3491  -25.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9377  -26.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3513  -27.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1805  -27.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5882  -26.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8852  -25.1073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2967  -25.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1217  -25.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5352  -25.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3602  -25.1107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7737  -24.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5987  -24.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3622  -23.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0084  -25.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8326  -25.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2470  -24.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8310  -23.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0081  -23.6845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7771  -22.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3662  -22.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5404  -22.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1270  -22.9732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5402  -23.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2987  -24.3934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7  9  1  0
 18 19  2  0
 19  9  1  0
  2  3  1  0
  3 20  1  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 22 23  1  0
  4  5  1  0
 23 24  1  0
 11 12  2  0
 24 25  1  0
  5  6  1  0
 25 26  1  0
 12 13  1  0
 25 27  1  0
 26 28  2  0
 13 14  2  0
 28 29  1  0
 14  8  1  0
 29 30  2  0
  6  7  1  0
 30 31  1  0
  9 15  2  0
 31 32  2  0
 32 26  1  0
  1  2  1  0
 27 33  2  0
 15 16  1  0
 33 34  1  0
  7  8  1  0
 34 35  2  0
 16 17  2  0
 35 36  1  0
  1  6  1  0
 36 37  2  0
 37 27  1  0
 17 18  1  0
 20 38  2  0
M  END

Alternative Forms

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.70Molecular Weight (Monoisotopic): 502.2984AlogP: 7.31#Rotatable Bonds: 10
Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.30CX LogP: 7.81CX LogD: 7.55
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: -0.56

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source