The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(9-isopropyl-6-(3-(pyridin-2-yl)phenylamino)-9H-purin-2-ylamino)butan-1-ol ID: ALA1080583
Cas Number: 1056016-06-8
PubChem CID: 46882055
Max Phase: Preclinical
Molecular Formula: C23H27N7O
Molecular Weight: 417.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(CO)Nc1nc(Nc2cccc(-c3ccccn3)c2)c2ncn(C(C)C)c2n1
Standard InChI: InChI=1S/C23H27N7O/c1-4-17(13-31)27-23-28-21(20-22(29-23)30(14-25-20)15(2)3)26-18-9-7-8-16(12-18)19-10-5-6-11-24-19/h5-12,14-15,17,31H,4,13H2,1-3H3,(H2,26,27,28,29)
Standard InChI Key: LWANFAFTTOKZAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-1.8556 -12.7833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8568 -13.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1419 -14.0235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1437 -12.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4284 -12.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4235 -13.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3684 -13.8629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8530 -13.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3605 -12.5183 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6279 -14.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0794 -15.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4359 -14.8128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5716 -14.0226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2857 -13.6095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0005 -14.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2850 -12.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7146 -13.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9992 -12.3715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1462 -11.5455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4330 -11.1309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2806 -11.5437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9933 -11.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9913 -10.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2706 -9.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4392 -10.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7088 -11.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7076 -12.3636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4223 -12.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1367 -12.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1320 -11.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4167 -11.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14 15 1 0
5 4 2 0
14 16 1 0
6 7 1 0
15 17 1 0
7 8 1 0
16 18 1 0
8 9 2 0
4 19 1 0
9 5 1 0
19 20 1 0
4 1 1 0
20 21 2 0
7 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
10 11 1 0
23 24 1 0
24 25 2 0
25 20 1 0
10 12 1 0
22 26 1 0
2 3 1 0
26 27 2 0
2 13 1 0
27 28 1 0
3 6 2 0
28 29 2 0
13 14 1 0
29 30 1 0
1 2 2 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.52Molecular Weight (Monoisotopic): 417.2277AlogP: 4.40#Rotatable Bonds: 8Polar Surface Area: 100.78Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.99CX Basic pKa: 4.51CX LogP: 3.95CX LogD: 3.95Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.39Np Likeness Score: -1.10
References 1. Morphy R.. (2010) Selectively nonselective kinase inhibition: striking the right balance., 53 (4): [PMID:20166671 ] [10.1021/jm901132v ]