1-benzhydryl-4-(2,2-diphenylethyl)piperazine

ID: ALA1080654

PubChem CID: 34885058

Max Phase: Preclinical

Molecular Formula: C31H32N2

Molecular Weight: 432.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(C(CN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc2)cc1

Standard InChI:  InChI=1S/C31H32N2/c1-5-13-26(14-6-1)30(27-15-7-2-8-16-27)25-32-21-23-33(24-22-32)31(28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-20,30-31H,21-25H2

Standard InChI Key:  HIAHXCOPTVPERH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -2.5595   -5.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7341   -5.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3237   -5.2671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7341   -4.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5595   -4.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9745   -5.2671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7999   -5.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2136   -4.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2116   -5.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7990   -3.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2120   -3.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0383   -3.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4499   -3.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0345   -4.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0366   -5.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4482   -6.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0345   -7.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2048   -7.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7969   -6.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4983   -5.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0866   -5.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7388   -5.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5003   -6.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1466   -6.7005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9712   -6.7020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3857   -5.9873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9696   -5.2696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1463   -5.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3239   -6.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7375   -7.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3257   -8.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4960   -8.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0862   -7.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
  7  8  1  0
 16 17  2  0
  1  6  1  0
 17 18  1  0
  7  9  1  0
 18 19  2  0
 19  9  1  0
  2  3  1  0
  3 20  1  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 21 23  1  0
  4  5  1  0
 22 24  2  0
 11 12  2  0
 24 25  1  0
  5  6  1  0
 25 26  2  0
 12 13  1  0
 26 27  1  0
 27 28  2  0
 28 22  1  0
 13 14  2  0
 23 29  2  0
 14  8  1  0
 29 30  1  0
  6  7  1  0
 30 31  2  0
  9 15  2  0
 31 32  1  0
  1  2  1  0
 32 33  2  0
 33 23  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.61Molecular Weight (Monoisotopic): 432.2565AlogP: 6.23#Rotatable Bonds: 7
Polar Surface Area: 6.48Molecular Species: BASEHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.67CX LogP: 7.06CX LogD: 5.77
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -0.68

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source