The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Hydroxy-2-{[(3-methyl-1-benzofuran-2-yl)carbonyl]hydrazono}-N'-(4-nitrophenyl)propanehydrazonamide ID: ALA1080766
PubChem CID: 135911826
Max Phase: Preclinical
Molecular Formula: C19H18N6O5
Molecular Weight: 410.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=N\NC(=O)c1oc2ccccc2c1C)/C(=N/Nc1ccc([N+](=O)[O-])cc1)NO
Standard InChI: InChI=1S/C19H18N6O5/c1-11-15-5-3-4-6-16(15)30-17(11)19(26)23-20-12(2)18(24-27)22-21-13-7-9-14(10-8-13)25(28)29/h3-10,21,27H,1-2H3,(H,22,24)(H,23,26)/b20-12+
Standard InChI Key: TVHQITCIBJQFBX-UDWIEESQSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
7.8596 0.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2435 -0.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0683 -0.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2977 1.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1213 1.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5081 0.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3272 0.7208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4467 1.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7014 1.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5618 2.7240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1768 1.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8745 1.4870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2093 2.7517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6047 1.8711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3023 1.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0325 1.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2698 0.6064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7302 1.3745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4603 1.7585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1580 1.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1210 0.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8179 0.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5490 0.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5790 1.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8815 1.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2495 -0.0026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9792 0.3824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2181 -0.8270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0650 2.6392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7951 3.0232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
14 15 2 0
5 4 2 0
15 16 1 0
6 7 1 0
15 17 1 0
7 8 1 0
16 18 2 0
8 9 2 0
18 19 1 0
9 5 1 0
19 20 1 0
4 1 1 0
20 21 2 0
9 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
8 11 1 0
23 24 1 0
24 25 2 0
25 20 1 0
11 12 1 0
2 3 1 0
11 13 2 0
26 27 2 0
26 28 1 0
23 26 1 0
3 6 2 0
16 29 1 0
12 14 1 0
29 30 1 0
M CHG 2 26 1 28 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.39Molecular Weight (Monoisotopic): 410.1339AlogP: 3.16#Rotatable Bonds: 6Polar Surface Area: 154.39Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.50CX Basic pKa: 2.86CX LogP: 3.30CX LogD: 3.30Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.21Np Likeness Score: -1.10
References 1. Abdel-Aziz HA, Mekawey AA.. (2009) Stereoselective synthesis and antimicrobial activity of benzofuran-based (1E)-1-(piperidin-1-yl)-N2-arylamidrazones., 44 (12): [PMID:19782439 ] [10.1016/j.ejmech.2009.09.002 ]