1-benzhydryl-4-(4,4-diphenylbutyl)piperazine

ID: ALA1081016

PubChem CID: 46879832

Max Phase: Preclinical

Molecular Formula: C33H36N2

Molecular Weight: 460.67

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(C(CCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc2)cc1

Standard InChI:  InChI=1S/C33H36N2/c1-5-14-28(15-6-1)32(29-16-7-2-8-17-29)22-13-23-34-24-26-35(27-25-34)33(30-18-9-3-10-19-30)31-20-11-4-12-21-31/h1-12,14-21,32-33H,13,22-27H2

Standard InChI Key:  MICPQZJRSOUTGV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   16.4667   -6.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2917   -6.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7019   -6.1728    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2917   -5.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4667   -5.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0519   -6.1728    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2269   -6.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8134   -5.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8154   -6.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2278   -4.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8150   -4.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9891   -4.0347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5777   -4.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9929   -5.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9908   -6.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5794   -7.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9929   -8.3177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8222   -8.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2299   -7.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5269   -6.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9384   -6.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7634   -6.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1769   -6.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0019   -6.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7654   -5.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4087   -6.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2329   -6.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6473   -6.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2313   -5.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4084   -5.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1793   -4.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7684   -4.0350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9426   -4.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5292   -4.7524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9424   -5.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  2  0
  1  6  1  0
 17 18  1  0
  7  9  1  0
 18 19  2  0
 19  9  1  0
  2  3  1  0
  3 20  1  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 22 23  1  0
  4  5  1  0
 23 24  1  0
 11 12  2  0
 23 25  1  0
  5  6  1  0
 24 26  2  0
 12 13  1  0
 26 27  1  0
 27 28  2  0
 13 14  2  0
 28 29  1  0
 14  8  1  0
 29 30  2  0
 30 24  1  0
  6  7  1  0
 25 31  2  0
  9 15  2  0
 31 32  1  0
  1  2  1  0
 32 33  2  0
 15 16  1  0
 33 34  1  0
  7  8  1  0
 34 35  2  0
 35 25  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.67Molecular Weight (Monoisotopic): 460.2878AlogP: 7.01#Rotatable Bonds: 9
Polar Surface Area: 6.48Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.45CX LogP: 7.87CX LogD: 6.78
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -0.65

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source