The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-benzhydryl-4-(3,3-diphenylpropyl)piperazine ID: ALA1081018
PubChem CID: 44756847
Max Phase: Preclinical
Molecular Formula: C32H34N2
Molecular Weight: 446.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(C(CCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc2)cc1
Standard InChI: InChI=1S/C32H34N2/c1-5-13-27(14-6-1)31(28-15-7-2-8-16-28)21-22-33-23-25-34(26-24-33)32(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-20,31-32H,21-26H2
Standard InChI Key: CLZJJBZJUIWHJT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
7.0292 -6.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8542 -6.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2644 -6.0895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8542 -5.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0292 -5.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6144 -6.0895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7894 -6.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3759 -5.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3779 -6.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7903 -4.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3775 -3.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5516 -3.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1402 -4.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5554 -5.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5533 -6.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1419 -7.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5554 -8.2344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3847 -8.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7924 -7.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0894 -6.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5009 -6.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3259 -6.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7374 -7.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7394 -6.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5642 -6.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9776 -5.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5661 -4.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7368 -4.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3271 -5.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3216 -8.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7324 -8.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5583 -8.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9716 -8.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5584 -7.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 8 1 0
16 17 2 0
1 6 1 0
17 18 1 0
7 9 1 0
18 19 2 0
19 9 1 0
2 3 1 0
3 20 1 0
8 10 2 0
20 21 1 0
3 4 1 0
21 22 1 0
10 11 1 0
22 23 1 0
4 5 1 0
22 24 1 0
11 12 2 0
24 25 2 0
5 6 1 0
25 26 1 0
12 13 1 0
26 27 2 0
27 28 1 0
13 14 2 0
28 29 2 0
29 24 1 0
14 8 1 0
23 30 2 0
6 7 1 0
30 31 1 0
9 15 2 0
31 32 2 0
1 2 1 0
32 33 1 0
15 16 1 0
33 34 2 0
34 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.64Molecular Weight (Monoisotopic): 446.2722AlogP: 6.62#Rotatable Bonds: 8Polar Surface Area: 6.48Molecular Species: BASEHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.59CX LogP: 7.42CX LogD: 6.21Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -0.71
References 1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP.. (2009) Scaffold-based design and synthesis of potent N-type calcium channel blockers., 19 (22): [PMID:19815411 ] [10.1016/j.bmcl.2009.09.008 ]